30 bài tập Este trong đề thi Đại học

1 415

Hóa học 12: 30 bài tập Este trong đề thi Đại học

VnDoc xin giới thiệu tới bạn đọc 30 bài tập Este trong đề thi Đại học. Chắc chắn nội dung tài liệu sẽ giúp các bạn giải Hóa 12 nhanh và chính xác nhất.

Câu 1. Khử este no, đơn chức, mạch hở X bằng LiAlH4, thu ancol duy nhất Y. Đốt cháy hoàn toàn Y thu 0,2 mol CO2 và 0,3 mol H2O. Đốt cháy hoàn toàn 0,1 mol X thu được tổng khối lượng CO2 và H2O là:

A. 24,8 gam

B. 28,4 gam

C. 16,8 gam

D. 18,6 gam

Khử este no, đơn chức, mạch hở X bằng LiAlH4 thu được ancol duy nhất Y

⇒ X có dạng R-COO-CH2-R

R-COO-CH2-R 30 bài tập Este trong đề thi Đại học 2RCH2OH

Đốt Y: n_{CO_2} = 0,2 và n_{H_2O} = 0,3 ⇒ nY = 0,1mol

Số C = 2 ⇒ Y là C2H5OH

⇒ X là CH3COOC2H5

nX = 0,1mol ⇒ n_{CO_2} = n_{H_2O} = 0,4mol

m_{CO_2} + m_{H_2O} = 24,8g

Câu 2. Đốt cháy hoàn toàn m gam hỗn hợp X gồm hai este đồng phân cần dùng 27,44 lít khí O2, thu được 23,52 lít khí CO2 và 18,9 gam H2O. Nếu cho m gam X tác dụng hết với 400 ml dung dịch NaOH 1M, cô cạn dung dịch sau phản ứng thì thu được 27,9 gam chất rắn khan, trong đó có a mol muối Y và b mol muối Z (My < Mz). Các thể tích khí đều đo ở điều kiện tiêu chuẩn. Tỉ lệ a : b là:

A. 2 : 3

B. 4 : 3

C. 3 : 2

D. 3 : 5

Nhận thấy n_{CO_2} = n_{H_2O} = 1,05 mol → hai este no đơn chức

Bảo toàn nguyên tố O → nO (este) = 2n_{CO_2} + n_{H_2O} - 2nO_2 = 1,05.3 - 2. 1,225 = 0,7 mol → neste = 0,35 mol

→ Ctb = 1,05 : 0,35 = 3 → hai este là đồng phân có cấu tạo HCOOC2H5 và CH3COOCH3

Khi cho X tác dụng với 0,4 mol NaOH → chất rắn thu được gồm HCOONa: a mol, CH3COONa: b mol, NaOH dư: 0,4 - 0,35 = 0,05 mol

nX = a + b = 0,35

mrắn = 68a + 82b + 0,05.40 = 27,9

⇒ a = 0,2 và b = 0,15

⇒ a : b = 4 : 3

Câu 3. Thủy phân este X mạch hở có công thức phân tử C4H6O2, sản phẩm thu được có khả năng tráng bạc. Số este X thỏa mãn tính chất trên là:

A. 4

B. 3

C. 6

D. 5

H−COO−CH=CH−CH3 + NaOH → H−COONa + CH3−CH2−CHO (Đp hình học).

H−COO−CH2−CH=CH2 + NaOH → H−COONa + CH2=CH−CH2−OH.

H−COO−C(CH3)=CH2 + NaOH → H−COONa + CH3−CO−CH3.

CH3−COO−CH=CH2 + NaOH → CH3−COONa + CH3−CHO

Câu 4. Số trieste khi thủy phân đều thu được sản phẩm gồm glixerol, axit CH3COOH và axit C2H5COOH là:

A. 9

B. 4

C. 6

D. 2

Có 4 CTCT thỏa mãn là CH2(OCOCH3)-CH(OCOCH3)-CH2(OCOC2H5),

CH2(OCOCH3)-CH(OCOC2H5)-CH2(OCOCH3),

CH2(OCOC2H5)-CH(OCOCH3)-CH2(OCOCH3),

CH2(OCOC2H5)-CH(OCOCH3)-CH2(OCOC2H5)

Câu 5. Este X là hợp chất thơm có công thức phân tử là C9H10O2. Cho X tác dụng với dung dịch NaOH, tạo ra hai muối đều có phân tử khối lớn hơn 80. Công thức cấu tạo thu gọn của X là:

A. CH3COOCH2C6H5

B. HCOOC6H4C2H5

C. C6H5COOC2H5

D. C2H5COOC6H5

Theo đề bài ⇒ X là este của phenol

Vì cả 2 muối có PTK > 80 ⇒ Gốc axit nhỏ nhất là CH3COO-

Suy ra, có 4 chất thỏa mãn: CH3COOC6H4CH3 (o-; m- ; p-) hoặc C2H5COOC6H5

Câu 6. Phát biểu nào sau đây là đúng?

A. Ancol etylic tác dụng được với dung dịch NaOH.

B. Axit béo là những axit cacboxylic đa chức.

C. Etylen glicol là ancol no, đơn chức, mạch hở.

D. Este isoamyl axetat có mùi chuối chín.

A sai vì ancol không phản ứng với NaOH

B sai vì là axit monocacboxylic

C sai vì etylen glicol là ancol no hai chức

Câu 7. Cho 0,1 mol tristearin (C17H35COO)3C3H5 tác dụng hoàn toàn với dung dịch NaOH dư, đun nóng, thu được m gam glixerol. Giá trị của m là:

A. 27,6.

B. 4,6.

C. 14,4.

D. 9,2.

30 bài tập Este trong đề thi Đại học

Ta có: nglixerol = ntristearin = 0,1mol → mglixerol = 0,1.92 = 9,2g

Câu 8. Thủy phân hoàn toàn m1 gam este X mạch hở bằng dung dịch NaOH dư, thu được m2 gam ancol Y (không có khả năng phản ứng với Cu(OH)2) và 15 gam hỗn hợp muối của hai axit cacboxylic đơn chức. Đốt cháy hoàn toàn m2 gam Y bằng oxi dư, thu được 0,3 mol CO2 và 0,4 mol H2O. Giá trị của m1 là:

A. 11,6.

B. 16,2.

C. 10,6.

D. 14,6.

Đốt cháy ancol Y ta được

nC : nH =n_{CO_2}: 2n_{H_2O} = 0,3 : 0,8 = 3 : 8

Mà ancol không phản ứng với Cu(OH)2 và este thủy phân tạo muối hữu cơ của 2 axit khác nhau

⇒ ancol Y là C3H8O2 : HOCH2CH2CH2OH

⇒ nancol = 0,1 mol ⇒ nNaOH = 2nancol = 0,2 mol

Bảo toàn khối lượng: m1 + mNaOH = mmuối + mancol

⇒ m1 = 14,6g

Câu 9. Este nào khi phản ứng với dung dịch NaOH dư, đun nóng không tạo ra hai muối?

A. C6H5COOC6H5 (phenyl benzoat).

B. CH3COOC6H5 (phenyl axetat).

C. CH3COO–[CH2]2–OOCCH2CH3.

D. CH3OOC–COOCH3

CH3OOC-COOCH3 + 2NaOH→ 2CH3OH + (COONa)2

Do đó D chỉ tạo ra 1 muối

Câu 10. Este X có tỉ khối hơi so với He bằng 21,5. Cho 17,2 gam X tác dụng với dung dịch NaOH dư, thu được dung dịch chứa 16,4 gam muối. Công thức của X là:

A. C2H3COOCH3

B. CH3COOC2H3

C. HCOOC3H5

D. CH3COOC2H5

MX = 86: C4H6O2

nmuối = nX = 0,2mol

⇒ Mmuối = 82: CH3COONa

⇒ X là CH3COOCH=CH2

Câu 11. Cho 26,4 gam hỗn hợp hai chất hữu cơ có cùng công thức phân tử C4H8O2 tác dụng với dung dịch NaOH vừa đủ, thu được dung dịch X chứa 28,8 gam hỗn hợp muối và m gam ancol Y. Đun Y với dung dịch H2SO4 đặc ở nhiệt độ thích hợp, thu được chất hữu cơ Z, có tỉ khối hơi so với Y bằng 0,7. Biết các phản ứng xảy ra hoàn toàn. Giá trị của m là:

A. 6,0

B. 6,4

C. 4,6

D. 9,6

Đáp án

30 bài tập Este trong đề thi Đại học

⇒ MY = 60: C3H7OH

⇒ Hỗn hợp ban đầu phải có axit C3H7COOH (x mol) và este HCOOC3H7 (y mol) thì sản phẩm mới thu được hỗn hợp muối và 1 ancol.

x + y = 0,3

mmuối = 110x + 68y = 28,8

⇒ x = 0,2 và y = 0,1

n_{C_3H_7OH}= 0,1 ⇒ m = 60.0,1 = 6g

Câu 12. Thủy phân 37 gam hai este cùng công thức phân tử C3H6O2 bằng dung dịch NaOH dư. Chưng cất dung dịch sau phản ứng thu được hỗn hợp ancol Y và chất rắn khan Z. Đun nóng Y với H2SO4 đặc ở 1400C, thu được 14,3 gam hỗn hợp các ete. Biết rằng phản ứng xảy ra hoàn toàn. Khối lượng muối trong Z là:

A. 40,0 gam

B. 38,2 gam

C. 42,2 gam

D. 34,2 gam

nY = nNaOH pư = n_{C_3H_6O_{_2}} = 0,5 mol

Este hóa Y ⇒n_{H_2O} = 0,25mol

Bảo toàn khối lượng ⇒ mY = mEte + m_{H_2O} = 18,8g

Bảo toàn khối lượng: mZ = m_{C_3H_6O_2} + mNaOH – mY = 38,2g

Câu 13. Hai este X, Y có cùng công thức phân tử C8H8O2 và chứa vòng benzene trong phân tử. Cho 6,8 gam hỗn hợp gồm X và Y tác dụng với dung dịch NaOH dư, đun nóng, lượng NaOH phản ứng tối đa là 0,06 mol, thu được dung dịch Z chứa 4,7 gam ba muối. Khối lượng muối của axit cacboxylic có phân tử khối lớn hơn trong Z là:

A. 0,82 g.

B. 0,68 g.

C. 2,72 g.

D. 3,40 g.

nEste = 0,05mol

nNaOH = 0,06mol

⇒ X là este của phenol (x mol) và Y là este của ancol (y mol)

x + y = 0,05 & nNaOH = 2x + y = 0,06

⇒ x = 0,01 và y = 0,04

(X, Y) + NaOH ⇒ Muối + Ancol + H2O

Bảo toàn khối lượng ⇒ mancol = 4,32g

nancol = y = 0,04 mol

⇒ M ancol = 108: C6H5-CH2OH

Vậy Y là HCOO-CH2-C6H5

Để tạo 3 muối thì X phải là CH3-COO-C6H5

n_{CH_3COONa} = x = 0,01mol

m_{CH_3COONa} = 0,82g

Câu 14. Thủy phân hoàn toàn 0,1 mol este X bằng NaOH, thu được một muối của axit cacboxylic Y và 7,6 gam ancol Z. Chất Y có phản ứng tráng bạc, Z hòa tan được Cu(OH)2 cho dung dịch màu xanh lam. Công thức cấu tạo của X là:

A. HCOOCH2CH2CH2OOCH.

B. HCOOCH2CH2OOCCH3.

C. CH3COOCH2CH2OOCCH3.

D. HCOOCH2CH(CH3)OOCH.

Muối Y có thể tráng gương ⇒ HCOONa

Z hòa tan được Cu(OH)2 điều kiện thường ⇒ có nhiều nhóm OH kề nhau

⇒ X là este của ancol đa chức và HCOOH

⇒ nancol = nX = 0,1 mol ⇒ Mancol = 76g (C3H6(OH)2)

⇒ X là HCOOCH2CH(CH3)OOCH

Câu 15. Đốt cháy hoàn toàn a gam triglixerit X cần vừa đủ 3,26 mol O2, thu được 2,28 mol CO2 và 39,6 gam H2O. Mặt khác, thủy phân hoàn toàn a gam X trong dung dịch NaOH, đun nóng, thu được dung dịch chứa b gam muối. Giá trị của b là:

A. 40,40

B. 31,92

C. 36,72

D. 35,60

Bảo toàn O ⇒ nX = 0,04 mol

Bảo toàn khối lượng cho phản ứng cháy ⇒ a = 39,6 + 2,28.44 - 3,26.32= 35,6g

nNaOH = 3nX = 0,12mol vàn_{C_3H_5(OH)_3} = nX = 0,04 mol

Bảo toàn khối lượng cho phản ứng xà phòng hóa:

b = a + mNaOH m_{C_3H_5(OH)_3} = 36,72 mol

Câu 16. Số este có công thức phân tử C4H8O2 mà khi thủy phân trong môi trường axit thì thu được axit fomic là:

A. 1.

B. 2.

C. 3.

D. 4.

Este đó phải có dạng HCOOC3H7

HCOOCH2 – CH2 – CH3

HCOOCH(CH3)2

Câu 17. Đun 3,0 gam CH3COOH với C2H5OH dư (xúc tác H2SO4 đặc), thu được 2,2 gam CH3COOC2H5. Hiệu suất của phản ứng este hóa tính theo axit là:

A. 25,00%.

B. 50,00%.

C. 36,67%.

D. 20,75%.

30 bài tập Este trong đề thi Đại học

Câu 18. Xà phòng hóa chất nào sau đây thu được glixerol?

A. Tristearin.

B. Metyl axetat.

C. Metyl fomat.

D. Benzyl axetat.

Tristearin: (C17H35COO)3C3H5 + 3NaOH → 3C17H35COONa + C3H5(OH)3

Câu 19. Thuỷ phân 4,4 gam etyl axetat bằng 100 ml dung dịch NaOH 0,2M. Sau khi phản ứng xảy ra hoàn toàn, cô cạn dung dịch, thu được m gam chất rắn khan. Giá trị của m là:

A. 2,90.

B. 4,28.

C. 4,10.

D. 1,64.

n_{CH_3COOC_2H_5} = 0,05 mol; nNaOH = 0,02 mol ⇒ este dư

rắn khan chỉ có 0,02 mol CH3COONa ⇒ m = 0,02 . 82 = 1,64g

Câu 20. Xà phòng hóa CH3COOC2H5 trong dung dịch NaOH đun nóng, thu được muối có công thức là

A. C2H5ONa

B. C2H5COONa

C. CH3COONa

D. HCOONa.

PTHH: CH3COOC2H5 + NaOH → CH3COONa + C2H5OH

Câu 21. Cho a mol este X (C9H10O2) tác dụng vừa đủ với 2a mol NaOH, thu được dung dịch không có phản ứng tráng bạc. Số công thức cấu tạo phù hợp của X là

A. 3.

B. 4

C. 2.

D. 6.

X tác dụng với dung dịch NaOH theo tỉ lệ 1: 2 nên X là este của phenol. X không tráng gương nên cấu tạo của X là:

CH3COOC6H4CH3 (Vị trí octo, meta, para)

C2H5COOC6H5

Có 4 đồng phân thỏa mãn

Câu 22. Este Z đơn chức, mạch hở, được tạo thành từ axit X và ancol Y. Đốt cháy hoàn toàn 2,15 gam Z, thu được 0,1 mol CO2 và 0,075 mol H2O. Mặt khác, cho 2,15 gam Z tác dụng vừa đủ với dung dịch KOH, thu được 2,75 gam muối. Công thức của X và Y lần lượt là

A. CH3COOH và C3H5OH.

B. C2H3COOH và CH3OH.

C. HCOOH và C3H5OH.

D. HCOOH và C3H7OH.

Số mol CO2 > số mol H2O ⇒ Z là este không no

Từ 4 đáp án ta có Z có 2π (1 π este và 1 π ở gốc hidrocacbon)

30 bài tập este trong đề thi Đại học | Bài tập Hóa học lớp 12 chọn lọc có đáp án

⇒ RCOOK = 110 ⇒ R = 27 (C2H3)

Câu 23. Chất X tác dụng với dung dịch NaOH vừa đủ, thu được 2 chất Y và Z. Cho Z tác dụng với dung dịch AgNO3 trong NH3 dư thu được chất hữu cơ T. Cho T tác dụng với dung dịch NaOH lại thu được Y. Chất Y là

A. CH3COOCH=CH2.

B. HCOOCH3.

C. CH3COOCH=CH-CH3.

D. HCOOCH=CH2.

Lưu ý 2 điểm sau để chọn được đáp án đúng:

- Quá trình biến đổi Z → T, T → Y không làm thay đổi số C → số CY = số CZ.

- Z + AgNO3/NH3; Ylà muối của axit cacboxylic → Z là anđehit.

A thỏa mãn

CH3COOCH=CH2 + NaOH → CH3COONa (Y) + CH3CHO (Z).

CH3CHO (Z) + 2AgNO3 + 3NH3 → CH3COONH4 (T) + 2NH4NO3 + 2Ag↓.

CH4COONH4 (T) + NaOH → CH3COONa (Y) + NH3 + H2O.

Câu 24. Este X đơn chức, mạch hở có tỉ khối so với oxi là 3,125. Đốt cháy hoàn toàn 0,2 mol hỗn hợp E gồm X và hai este Y, Z (đều no, mạch hở, MY < MZ), thu được 0,7 mol CO2. Biết E phản ứng với dung dịch KOH vừa đủ chỉ thu được hai ancol (có cùng số nguyên tử cacbon) và hỗn hợp hai muối. Phân tử khối của Z là

A. 132

B. 118

C. 146

D. 136.

- MX = 3,125.32 = 100 (C5H8O2) không no

- Số C TB trong E = 0,7/0,2 = 3,5 . Vậy phải có este có số C < 3,5

- Vì 3 este, mà Y nhỏ nhất nên Y là: HCOOCH3 hay HCOOC2H5

- Vì khi thuỷ phân 3 este thu 2 muối và 2 ancol cùng số C, nên phải chọn Y là HCOOC2H5 để có 2 ancol là C2H5OH

và C2H4(OH)2

Vậy 3 este phải tạo từ 2 ancol này.

- Cuối cùng:

+ Y: HCOOC2H5

+ X: CH2=CH-COOC2H5 (không có CT nào phù hợp)

+ Z: phải là HCOO- CH2-CH2OOCH no, tạo muối trúng muối của Y

- MZ = 118

Câu 25. Hình vẽ sau đây mô tả thí nghiệm điều chế chất hữu cơ Y:

30 bài tập Este trong đề thi Đại học

Phản ứng nào sau đây xảy ra trong thí nghiệm trên?

A. 2C6H12O6 + Cu(OH)2 → (C6H11O6)2Cu + H2O

B. CH3COOH + C2H5OH ⇆ CH3COOC2H5 + H2O

C. H2NCH2COOH + NaOH → H2NCH2COONa + H2O

D. CH3COOH + NaOH → CH3COONa + H2O

PT: CH3COOH + C2H5OH ⇆ CH3COOC2H5 + H2O

Câu 26. Xà phòng hoá hoàn toàn 178 gam tristearin trong dung dịch KOH, thu được m gam kali stearat. Giá trị của m là

A. 200,8

B. 183,6

C. 211,6.

D. 193,2.

Đáp án

30 bài tập Este trong đề thi Đại học

(C17H35COO)3C3H5 + 3KOH → 3C17H35COOK + C3H5(OH)3

nmuối = 3.0,2=0,6 mol

M = 322.0,6 = 193,2 g

Câu 27. Hỗn hợp E gồm bốn este đều có công thức C8H8O2 và có vòng benzen. Cho m gam E tác dụng tối đa với 200 ml dung dịch NaOH 1M (đun nóng), thu được hỗn hợp X gồm các ancol và 20,5 gam hỗn hợp muối. Cho toàn bộ X vào bình đựng kim loại Na dư, sau khi phản ứng kết thúc khối lượng chất rắn trong bình tăng 6,9 gam so với ban đầu. Giá trị của m là

A. 13,60

B. 8,16

C. 16,32

D. 20,40.

E gồm các este của ancol (tổng x mol) và các este của phenol (tổng y mol)

nNaOH = x + 2y = 0,2 (1)

nAncol = x mol ⇒ n_{H_2} = 0,5x mol

⇒ mAncol = mtăng + m_{H_2} = x + 6,9 g

n_{H_2O} = nEste = y mol

Bảo toàn khối lượng:

136(x + y) + 0,2.40 = 20,5 + (x + 6,9) + 18y (2)

(1) và (2) ⇒ x = 0,1 và y = 0,05 mol

⇒ m = 136(x + y) = 20,4g

Câu 28. Hỗn hợp E gồm 4 este đều có công thức C8H8O2 và có vòng benzen.Cho 16,32 gam E tác dụng tối đa với V lít dung dịch NaOH 1M (đun nóng), thu được hỗn hợp X gồm các ancol và 18,78 gam hỗn hợp muối. Cho hoàn toàn X vào bình đựng kim loại Na dư, sau khi phản ứng kết thúc khối lượng chất rắn trong bình tăng 3,83 gam so với ban đầu. Giá trị của V là

A. 190

B. 100

C. 120

D. 240.

E gồm các este của ancol (tổng x mol) và các este của phenol (tổng y mol)

nE = x + y = 0,12 (1)

nAncol = x ⇒n_{H_2} = 0,5x mol

⇒ mAncol = mtăng + m_{H_2} = x + 3,83 g

nNaOH = x + 2y mol và n_{H_2O} = y mol

Bảo toàn khối lượng:

16,32 + 40(x + 2y) = 18,78 + (x + 3,83) + 18y (2)

(1)(2) ⇒ x = 0,05 và y = 0,07

⇒ nNaOH = x + 2y = 0,19 mol

⇒ V = 190 ml

Câu 29. Cho m gam hỗn hợp X gồm ba etse đều đơn chức tác dụng tối đa với 400 ml dung dịch NaOH 1M, thu được hỗn hợp Y gồm hai ancol cùng dãy đồng đẳng và 34,4 gam hỗn hợp muối Z. Đốt cháy hoàn toàn Y, thu được 3,584 lít khí CO2 (đktc) và 4,68 gam H2O. Giá trị của m là:

A. 24,24

B. 25,14

C. 21,10

D. 22,44.

Đốt Y ⇒ n_{CO_2} = 0,16 mol và n_{H_2O} = 0,26 mol

⇒ nY =n_{H_2O}n_{CO_2} = 0,1 mol

30 bài tập Este trong đề thi Đại học

⇒ Y chứa các ancol đơn chức ⇒ nO = 0,1mol

mY = mC + mH + mO = 4,04 g

nEste của ancol = 0,1mol

và nEste của phenol = x mol

⇒ nNaOH = 0,1 + 2x = 0,4 mol

⇒ x = 0,15 ⇒ n_{H_2O} = 0,15mol

Bảo toàn khối lượng:

mX = mmuối + mY + m_{H_2O} – mNaOH = 25,14g

Câu 30. Cho m gam hỗn hợp X gốm ba este đểu đơn chức tác dụng tối đa với 350 ml dung dịch NaOH 1M. thu được hỗn hợp Y gồm hai ancol cùng dãy đồng đẳng và 28,6 gam hỗn hợp muối Z. Đốt cháy hoàn toàn Y, thu được 4,48 lít khí CO2 (đktc) và 6.3 gam H2O. Giá trị của m là

A. 21,9

B. 30,4

C. 20,1

D. 22,8.

Đốt Y ⇒ n_{CO_2}= 0,2 mol và n_{H_2O}= 0,35mol

⇒ nY = n_{H_2O}n_{CO_2} = 0,15 mol

⇒ nO(Y) = 0,15 mol

mY = mC + mH + mO = 5,5g

X gồm este của ancol (0,15 mol) và este của phenol (x mol)

nNaOH = 0,15 + 2x = 0,35 mol

⇒ x = 0,1⇒ n_{H_2O} = 0,1 mol

Bảo toàn khối lượng:

mX = mmuối + mY + m_{H_2O} – mNaOH = 21,9g

Mời các bạn tham khảo thêm các bài viết dưới đây của chúng tôi:

Trên đây VnDoc đã giới thiệu tới các bạn 30 bài tập Este trong đề thi Đại học. Để có kết quả cao hơn trong học tập, VnDoc xin giới thiệu tới các bạn học sinh tài liệu Giải bài tập Toán lớp 12, Giải bài tập Hóa học lớp 12, Giải bài tập Vật Lí 12, Tài liệu học tập lớp 12VnDoc tổng hợp và đăng tải.

Đánh giá bài viết
1 415
Chuyên đề Hóa học lớp 12 Xem thêm