Giải bài tập Hóa học 12 SBT bài 2

1 32

Giải bài tập Hóa học 12 sách bài tập bài Lipit

VnDoc mời các bạn học sinh tham khảo tài liệu Giải bài tập Hóa học 12 SBT bài 2, tài liệu kèm theo đáp án sẽ là nguồn thông tin hay để giúp các bạn học sinh rèn luyện giải Hóa 12 nhanh và chính xác nhất. Mời các bạn học sinh và thầy cô cùng tham khảo.

Giải bài tập Hóa học 12

Bài 1.14; 1.15; 1.16 trang 6 sách bài tập (SBT) Hoá học 12

1.14. Phát biểu nào sau đây không đúng?

A. Chất béo là trieste của glyxerol và các monocacboxylic có mạch cacbon dài, không phân nhánh

B. Chất béo chứa chủ yếu các gốc no của axit thường là chất rắn ở nhiệt độ phòng.

C. Chất béo chứa chủ yếu các gốc không no của axit thường là chất lỏng ở nhiệt độ phòng và được gọi là dầu.

D. Phản ứng thuỷ phân chất béo trong môi trường kiềm là phản ứng thuận nghịch.

1.15. Chất béo có đặc điểm chung nào sau đây?

A. Không tan trong nước, nặng hơn nước, có trong thành phần chính của dầu, mỡ động, thực vật.

B. Không tan trong nước, nhẹ hơn nước, có trong thành phần chính của dầu, mỡ động, thực vật

C. Là chất lỏng, không tan trong nước, nhẹ hơn nước, có trong thành phần chính của dầu, mỡ động, thực vật.

D. Là chất rắn, không tan trong nước, nhẹ hơn nước, có trong thành phần chính của dầu, mỡ động, thực vật.

1.16. Khi thuỷ phân chất béo X trong dung dịch NaOH, thu được hỗn hợp hai muối C17H35COONa, C5H31COONa có khối lượng hơn kém nhau 1,817 lần và glixerol. Trong phân tử X có

A. 3 gốcC17H35COO.

C. 2 gốc C15H31COO.

B. 2 gốc C17H35COO.

D. 3 gốcC15H31COO.

Hướng dẫn trả lời:

Chọn đáp án

1.14. D

1.15. B

1.16. C

Bài 1.17 trang 6 sách bài tập (SBT) Hoá học 12

Cho một lượng tristearin (triglixerit của axit stearic với glixerol) vào cốc thuỷ tinh chịu nhiệt đựng một lượng dư dung dịch NaOH, thấy chất trong cốc tách thành hai lớp; đun sôi hỗn hợp đồng thời khuấy đều một thời gian đến khi thu được chất lỏng đồng nhất; để nguội hỗn hợp và thêm vào một ít muối ăn, khuấy cho tan hết thấy hồn hợp tách thành hai lớp: phía trên là chất rắn màu trắng, dưới là chất lỏng. Hãy giải thích quá trình thí nghiệm trên bằng phương trình hoá học.

Hướng dẫn trả lời:

Sản phẩm của phản ứng tan được trong nước nên thu được chất lỏng đồng nhất. Khi để nguội và thêm muối ăn vào hỗn hợp thì muối natri stearat nổi lên trên do nó nhẹ hơn lớp chất lỏng phía dưới. Muối ăn thêm vào nhằm làm tăng khối lượng riêng của dung dịch và làm giảm độ tan của muối natri stearat.

Bài 1.18 trang 6 sách bài tập (SBT) Hóa học 12

Đun sôi 8,9 g triglixerit X là chất rắn trong duns dịch NaOH vừa đủ đến khi phản ứng hoàn toàn thu được 0,92 g glixerol và m gam muối của axit béo X. Tính m và tìm công thức cấu tạo của X

Hướng dẫn trả lời:

(RCOO)3C3H5 + 3NaOH → 3RCOONa + C3H5(OH)3

0,01 mol 0,03 mol 0,03 mol ← 0,01 mol

{M_X} = {{8,9} \over {0,01}} = {\rm{ }}890{\rm{ }}g/mol

3R + 3.44 + 41 = 890 ⟹ R = 239.

Vì X rắn nên gốc R là gốc no: CnH2n + 1 ⟹ 14n + 1 = 239.

⟹ n = 17, Vậy X: (C17H35COO)3C3H5.

Khối lượng của muối: m = mX + mNa0H - mglixerol= 8,9+ 0,03.40-0,92 = 9,18 (g).

Bài 1.19 trang 7 sách bài tập (SBT) Hoá học 12

Đun sôi a gam một triglixerit X với dung dịch kali hiđroxit (dư) đến khi phản ứng hoàn toàn thu được 0,92 g glixerol và m gam hỗn hợp Y gồm muối của axit oleic (C17H33COOH) và 3,18 g muối của axit linoleic (C17H31COOH).

a) Tìm công thức cấu tạo có thể có của triglixerit trên.

b) Tính a.

Hướng dẫn trả lời:

a) n C3H5(OH)3 = 0,01mol

X là triglixerit của glixerol với axit oleic và axit linoleic nên có công thức dạng (C17H31COO)xC3H5(OOCC17H33)y, với x + y = 3.

Phản ứng của X với KOH:

(C17H31COO)xC3H5(OOCC17H33)y + 3KOH → xC17H31COOK + yC17H33COOK + C3H5(OH)3

Từ pt: nC17H31COOK = x.n C3H5(OH)3 = 0,01x mol = {{3,18} \over {318}} = 0,01 mol

→ x = 1 →y = 2

X có công thức cấu tạo: C17H31COOC3H5(OOCC17H33)2.

b) Ta có: nC17H33COOK = 0,02 mol ⟹ mC17H33COOK = 0,02.320 = 6,4 (g)

Áp dụng định luật bảo toàn khối lượng, ta có:

a = (0,92 + 6,4 + 3,18)- 0,03.56 = 8,82 (g)


Để có kết quả cao hơn trong học tập, VnDoc xin giới thiệu tới các bạn học sinh tài liệu Giải bài tập Toán lớp 12, Giải bài tập Hóa học lớp 12, Giải bài tập Vật Lí 12 mà VnDoc tổng hợp và đăng tải.

Đánh giá bài viết
1 32
Giải SBT Hóa học 12 Xem thêm