Giáo án Hóa học lớp 12 bài 12: Luyện tập cấu tạo và tính chất của amin, amino axit và protein

1 458

Giáo án môn Hóa học lớp 12

Giáo án Hóa học lớp 12 bài 12: Luyện tập cấu tạo và tính chất của amin, amino axit và protein được VnDoc sưu tầm và giới thiệu để có thể chuẩn bị giáo án và bài giảng hiệu quả, giúp quý thầy cô tiết kiệm thời gian và công sức làm việc. Giáo án môn Hóa học 12 này được soạn phù hợp quy định Bộ Giáo dục và nội dung súc tích giúp học sinh dễ dàng hiểu bài học hơn.

I. MỤC TIÊU BÀI HỌC

1. Kiến thức: So sánh, củng cố kiến thức về cấu tạo cũng như tính chất của amin, amino axit và protein.

2. Kỹ năng:

  • Làm bảng tổng kết về các hợp chất quan trọng trong chương.
  • Viết các PTHH của phản ứng dưới dạng tổng quát cho các hợp chất amin, amino axit.
  • Giải các bài tập hoá học phần amin, amino axit và protein.

Trọng tâm: Cấu tạo của amin, amino axit và protein. Tính chất hóa học cơ bản của amin.

3. Tư tưởng: Có thể khám phá được những hợp chất cấu tạo nên cơ thể sống và thế giới xung quanh.

II. CHUẨN BỊ CỦA GIÁO VIÊN VÀ HỌC SINH

1. Giáo viên:

  • Bảng tổng kết một số hợp chất quan trọng của amin, amino axit.
  • Hệ thống câu hỏi cho bài dạy.

2. Học sinh: Làm hết BTVN trước khi đến lớp

III. PHƯƠNG PHÁP

Dùng BT để củng cố kiến thức

IV. TIẾN TRÌNH BÀI GIẢNG

1. Ổn định tổ chức:

2. Kiểm tra bài cũ: Trong giờ học

3. Bài mới:

Hoạt động của Giáo viên và Học sinh

Nội dung ghi bảng

* Hoạt động 1:

- GV: GV sử dụng bảng phụ, yêu cầu HS hoạt động theo nhóm: thảo luận rồi điền vào bảng:

HS: Thảo luận theo nhóm và điền thông tin

- GV: Nhận xét và bổ sung

HS: Nghe TT

I. KIẾN THỨC CẦN NHỚ

Loại hợp chất

Amin bậc I

Aminoaxit

Protein

CTCT

     

Nhóm chức đặc trưng

     

Tính chất hoá học

     

 

 

* Hoạt động 2:

- GV: Trước tiên chúng ta làm các BTTN sau

HS:

v HS 1 chọn đáp án phù hợp.

v HS 2 nhận xét về đáp án HS 1 chọn.

- GV: Nhận xét và bổ sung

HS: Nghe TT

II. BÀI TẬP

Bài 1: Dung dịch nào dưới đây làm quỳ tím hoá xanh?

A. CH3CH2CH2NH2P

B. H2N−CH2−COOH

C. C6H5NH2

D. H2NCH(COOH)CH2CH2COOH

Bài 2: C2H5NH2 tan trong nước không phản ứng với chất nào trong số các chất sau?

A. HCl

B. H2SO4

C. NaOHP

D. Quỳ tím

* Hoạt động 3:

- GV: Tiếp theo các em làm BT về ptpư

HS: HS vận dụng các kiến thức đã học về amino axit để hoàn thành PTHH của phản ứng.

- GV: HD: tirozin thuộc loại hợp chất gì?

HS: amino axit

 

 

 

 

 

 

 

- GV: Nhận xét và bổ sung

HS: Nghe TT

Bài 3: Viết các PTHH của phản ứng giữa tirozin

giáo án môn hóa học lớp 12

với các chất sau đây:

a) HCl b) Nước brom

c) NaOH d) CH3OH/HCl (hơi bão hoà)

Giải

a) HO-C6H4-CH2-CH(NH2)-COOH + HCl →

HO-C6H4-CH2-CH(NH3Cl)-COOH

b) HO-C6H4-CH2-CH(NH2)-COOH + 2Br2

HO-C6H2Br2-CH2-CH(NH2)-COOH + 2HBr

c) HO-C6H4-CH2-CH(NH2)-COOH + 2NaOH →

NaO-C6H4-CH2-CH(NH2)-COONa + 2H2O

d) HO-C6H4-CH2-CH(NH2)-COOCH3 + H2O -> 

HO-C6H4-CH2-CH(NH2)-COOCH3 + H2O

* Hoạt động 4: Kiểm tra 15 phút

- GV: Tiếp theo các em làm KT 15 phút tại lớp

→ HS: Làm và nộp bài cho GV

 

 

 

 

 

 

 

 

 

 

- GV: Nhận xét và bổ sung

HS: Nghe TT

KT 15’

Câu 1: Trình bày phương pháp hoá học phân biệt dung dịch từng chất trong các nhóm chất sau:

CH3NH2, H2N-CH2-COOH, CH3COONa

Câu 2: Viết ptpư xảy ra khi cho glyxerin tác dụng với KOH, HCl

Câu 1:

 

CH3NH2

H2N-CH2-COOH

CH3COONa

Quỳ tím

Xanh (1)

(nhận ra glyxin)

Xanh (2)

dd HCl

khói trắng

 x

 

Câu 2:
NH2-CH2-COOH + HCl → CH2(NH3Cl)-COOH

NH2-CH2-COOH + NaOH → NH2-CH2-COONa + H2O

4. Củng cố bài giảng:

Trình bày phương pháp hoá học phân biệt dung dịch từng chất trong các nhóm chất sau: C6H5NH2, CH3-CH(NH2)-COOH, C3H5(OH)3, CH3CHO

--- // ---

 

C6H5NH2

Alanin

Glixerol

CH3CHO

Cu(OH)2, lắc nhẹ

Dd trong suốt màu xanh lam (1)

↓ đỏ gạch (2)

Cu(OH)2, t0

 x  x

Dung dịch Br2

↓ trắng (3)

 x  x

 5. Bài tập về nhà:

- Bài tập: Cho 0,01 mol amino axit A tác dụng vừa đủ với 80 ml dung dịch HCl 0,125M; sau phản ứng đem cô cạn thì thu được 1,815g muối. Nếu trung hoà A bằng một lượng vừa đủ NaOH thì thấy tỉ lệ mol giữa A và NaOH là 1:1.

Xem trước bài ĐẠI CƯƠNG VỀ POLIME

Đánh giá bài viết
1 458
Giáo án Hóa học lớp 12 Xem thêm