Các dạng bài tập về phản ứng thủy phân este

Các dạng bài tập về phản ứng thủy phân este

Các dạng bài tập về phản ứng thủy phân este được VnDoc.com sưu tầm và đăng tải là tài liệu ôn tập môn Hóa học lớp 12 hữu ích dành cho các bạn học sinh, giúp các bạn luyện tập và nâng cao kỹ năng làm bài hiệu quả. Đây cũng là tài liệu hữu ích dành cho quý thầy cô giáo dùng để soạn đề và ra bài tập về nhà, mời quý thầy cô giáo và các bạn tham khảo.

200 câu trắc nghiệm lý thuyết Este - Lipit

Các dạng bài tập trắc nghiệm Este - Lipit

TÍNH LƯỢNG CHẤT DỰA VÀO PHẢN ỨNG THỦY PHÂN ESTE ĐƠN CHỨC

Câu 1. Xà phòng hóa 8,8 gam etyl axetat bằng 200 ml dung dịch NaOH 0,2M. Sau khi phản ứng xảy ra hoàn toàn, cô cạn dung dịch thu được chất rắn khan có khối lượng là (cho H = 1, C = 12, O = 16, Na = 23)

A. 3,28 gam         B. 10,4 gam          C. 8,56 gam          D. 8,2 gam

Câu 2. Cho 16,72 gam metyl propionat tác dụng với 100ml hh NaOH 1M và KOH 1M. Cô cạn dd sau pư khối lượng chất rắn là

A. 26,24            B. 22,24             C. 20,24             D. 21,6

Câu 3. Cho 1 gam este X có công thức HCOOCH2CH3 tác dụng với nước (xúc tác axit). Sau một thời gian, trung hòa hỗn hợp bằng dung dịch NaOH 0,1M thấy cần đúng 45ml. Tỷ lệ % este chưa bị thủy phân là:

A. 33,3%            B. 50%              C. 60%             D. 66,7%

Câu 4. Cho 20,8 gam hỗn hợp gồm metyl fomat và metyl axetat tác dụng với NaOH thì hết 150 ml dung dịch NaOH 2M. Khối lượng metyl fomat trong hỗn hợp là

A. 3,7 gam          B. 3 gam             C. 6 gam            D. 3,4 gam

Câu 5. Xà phòng hoá hoàn toàn 22,2 gam hỗn hợp gồm hai este HCOOC2H5 và CH3COOCH3 bằng dung dịch NaOH 1M (đun nóng). Thể tích dung dịch NaOH tối thiểu cần dùng là

A. 400 ml           B. 300 ml            C. 150 ml            D. 200 ml

XÁC ĐỊNH CÔNG THỨC HÓA HỌC CỦA ESTE ĐƠN CHỨC DỰA VÀO PHẢN ỨNG THỦY PHÂN

Câu 1. Cho este C3H6O2 xà phòng hoá bởi NaOH thu được muối có khối lượng bằng 41/37 khối lượng este. Tìm CTCT của este.

Câu 2. Cho 6 gam một este của axit cacboxylic no đơn chức và ancol no đơn chức phản ứng vừa hết với 100 ml dung dịch NaOH 1M. Tên gọi của este đó là

A. etylaxetat         B. Propylfomat         C. Metylfomat        D. Metylaxetat

Câu 3. X là một este no đơn chức, có tỉ khối hơi đối với CH4 là 5,5. Nếu đem đun 2,2 gam este X với dung dịch NaOH (dư), thu được 2,05 gam muối. Công thức cấu tạo thu gọn của X là:

A. C2H5COOCH3                        B. HCOOCH2CH2CH3
C. CH3COOC2H5                        D. HCOOCH(CH3)2

Câu 4. Cho 4,2 gam este đơn chức no E tác dụng hết với dung dịch NaOH ta thu được 4,76 gam muối natri. Vậy công thức cấu tạo của E có thể là:

A. CH3 –COOCH3    B. HCOOCH3          C. CH3COOC2H5     D. HCOOC2H5

Câu 5. Cho 20 gam một este X (có phân tử khối là 100 đvC) tác dụng với 300 ml dung dịch NaOH 1M. Sau phản ứng, cô cạn dung dịch thu được 23,2 gam chất rắn khan. Công thức cấu tạo của X là

A. CH2=CHCH2COOCH3                  B. CH3COOCH=CHCH3
C. C2H5COOCH=CH2                     D. CH2=CHCOOC2H5

Câu 6. Xà phòng hoá 17,6 gam este đ/c bằng 100 ml NaOH 1M và KOH 1M vùa đủ được 20,8 gam muối. XĐ tên este

A. etyl axetat        B. Etyl fomat           C. Metyl propionat     D. Metyl fomat

XÁC ĐỊNH CÔNG THỨC HÓA HỌC CỦA ESTE ĐƠN CHỨC ĐẶC BIỆT

Câu 1. Cho 12,9 gam một este đơn chức, mạch hở tác dụng hết với 150 ml dd KOH 1M. Sau phản ứng thu được một muối và anđehit. Số CTCT của este thoả mãn tính chất trên là:

A. 1                B. 2                  C. 3                D. 4

Câu 2. Hợp chất X có công thức phân tử C5H8O2. Cho 5 gam X tác dụng hết với dd NaOH, thu được một hợp chất hữu cơ không làm mất màu dd nước Brom và 3,4 gam một muối. CTCT của X là:

A. HCOOCH2CH=CHCH3                  B. HCOOCH=CHCH2CH3
C. CH3COOC(CH3)=CH2                   D. HCOOC(CH3)=CHCH3

Câu 3. Thủy phân 4,3 gam este X đơn chức, mạch hở (có xúc tác axit) đến khi phản ứng hoàn toàn thu được hỗn hợp hai chất hữu cơ Y và Z. Cho Y, Z phản ứng dd AgNO3/NH3 dư thu được 21,6 gam bạc. CTCT của X là

A. CH3COOCH=CH2                      B. HCOOCH=CHCH3
C. HCOOCH2CH=CH2                    D. HCOOC(CH3)=CH2

Câu 4. E có công thức cấu tạo là HCOOCH=CH2. Đun nóng m gam E sau đó lấy toàn bộ các sản phẩm sinh ra thực hiện phản ứng tráng gương thu được tổng khối lượng Ag là 10,8 gam Ag. Hiđro hóa m gam E bằng H2 xúc tác Ni,t0 vừa đủ thu được E'. Đốt cháy toàn bộ lượng E' rồi dẫn vào bình đựng dung dịch NaOH dư thì khối lượng bình tăng thêm bao nhiêu gam?

A. 55,8 gam          B. 46,5 gam          C. 42 gam           D. 48,2 gam

Este của phenol- ESTE CÓ DẠNG RCOO-CnH2n-7

Câu 1. Đun 9,9 gam phenyl bezoat với 150 ml dung dịch NaOH 1M. Cô cạn dung dịch sau phản ứng thu được m gam chất rắn khan. Giá trị của m là:

A. 7,2 gam           B. 13 gam            C. 15 gam           D. 21,6 gam

Câu 2. Trộn 13,6 gam phenyl axetat với 250 ml dung dịch NaOH 1M. Sau khi phản ứng xảy ra hoàn toàn cô cạn dung dịch sau phản ứng thu được m gam chất rắn khan. Giá trị của m là:

A. 8,2 gam           B. 10,2 gam          C. 19,8 gam         D. 21,8 gam

Câu 3. Cho 27,6 gam hợp chất thơm X có CT C7H6O3 T/d với 800 ml dd NaOH 1M được dd Y. Trung hòa Y cần 100 ml dd H2SO4 1M được dd Z. Khối lượng chất rắn thu được khi cô cạn dd Z là

A. 31,1 gam          B. 56,9 gam          C. 58,6 gam         D. 62,2 gam

Câu 4. Cho axit salixylic (axit o-hiđroxibenzoic) P/ư với anhiđrit axetic được axit axetylsalixylic (o-CH3COO-C6H4-COOH). Để P/ư hoàn toàn với 43,2 gam axit axetylsalixylic cần vừa đủ V lít dd KOH 1M. Giá trị của V là:

A. 0,72              B. 0,48              C. 0,96             D. 0,24

Câu 5. Cho 13,6 gam este đơn chức (phân tử có một vòng thơm) Tác dụng vừa đủ với 200 ml NaOH 1M được 19,8 gam muối. Cấu tạo của este là:

A. CH3COOC6H5     B. HCOOC6H5        C. C2H3COOC6H5    D. CH3COOCH2C6H5

Câu 6. Đốt cháy 1,7 gam este X cần 2,52 lít oxi (đktc), chỉ sinh ra CO2 và H2O với tỉ lệ số mol nCO2: nH2O = 2. Đun nóng 0,01 mol X với dung dịch NaOH thấy 0,02 mol NaOH tham gia phản ứng. X không có chức ete, không phản ứng với Na trong điều kiện bình thường và không khử được AgNO3, trong amoniac ngay cả khi đun nóng. Biết Mx < 140 đvC. Hãy xác định công thức cấu tạo của X?

A. HCOOC6H                           B. CH3COOC6H5
C. C2H5COOC6H5                       D. C2H3COOC6H5

Este vòng

Câu 1. Một este đơn chức X có tỉ khối hơi so với oxi là 3,125. Cho 0,15 mol X tác dụng vừa đủ với dung dịch NaOH rồi cô cạn thu được 21 gam muối. Biết X có cấu tạo mạch không phân nhánh, công thức cấu tạo của X là:

Ôn tập Hóa học lớp 12

Câu 2. Đốt cháy 0,8 gam một este X đơn chức được 1,76 gam CO2 và 0,576 gam H2O. Cho 5 gam X tác dụng với lượng NaOH vừa đủ, cô cạn dung dịch sau phản ứng được 7 gam muối khan Y. Cho Y tác dụng với dung dịch axit loãng thu được Z không phân nhánh. Công thức cấu tạo của X là:

A. Ôn tập Hóa lớp 12    B.      Bài tập Hóa học lớp 12    C. Bài tập este Hóa học lớp 12      D. CH2=CH-COOC2H5

Câu 3. Xà phòng hóa một este no đơn chức A bằng một lượng vừa đủ dung dịch NaOH chỉ thu được sản phẩm duy nhất B. Nung B với vôi tôi xút thu được ancol D và muối vô cơ. Đốt cháy hoàn toàn ancol D thu được CO2 và H2O có tỉ lệ thể tích 3 : 4. Biết A có cấu tạo mạch không phân nhánh, công thức cấu tạo của A là:

Bài tập este hóa lớp 12

XÁC ĐỊNH CÔNG THỨC HÓA HỌC CỦA HỖN HỢP ESTE ĐƠN CHỨC ĐỒNG ĐẲNG DỰA VÀO PHẢN ỨNG THỦY PHÂN

Câu 1. Cho hỗn hợp E gồm 2 este có công thức phân tử C4H8O2 và C3H6O2 tác dụng hoàn toàn với NaOH dư thu được 6,14 gam hỗn hợp 2 muối và 3,68 gam một ancol Y duy nhất có tỉ khối so với oxi là 1,4375. Công thức cấu tạo mỗi este và số gam tương ứng là

A. C2H5COOCH3 (6,6g); CH3COOCH3 (1,48g)
B. CH3COOC2H5 (4,4g); HCOOC2H5 (2,22g)
C. C2H5COOCH3 (4,4g); CH3COOCH3 (2,22g)
D. CH3COOC2H5 (6,6g); HCOOC2H5 (1,48g)

Câu 2. Xà phòng hoá hoàn toàn 9,7 g hỗn hợp hai este đơn chức X, Y cần 100ml dd NaOH 1,5M. Sau phản ứng cô cạn dd thu được hỗn hợp hai ancol đồng đẳng kế tiếp và một muối duy nhất. CTCT thu gọn của X, Y là

A. HCOOCH3 và HCOOC2H5             B. CH3COOCH3 và CH3COOC2H5
C. C2H5COOCH3 và C2H5COOC2H5        D. C3H7COOCH3 và C4H9COOC2H5

Câu 3. Xà phòng hóa hoàn toàn 1,99 gam hỗn hợp hai este bằng dd NaOH thu được 2,05 gam muối của một axit và 0,94 gam hỗn hợp hai ancol là đồng đẳng kế tiếp nhau. CTCT của hai este đó là:

A. HCOOCH3 và HCOOC2H5              B. C2H5COOCH3 và C2H5COOC2H5
C. CH3COOC2H5 và CH3COOC3H7         D. CH3COOCH3 và CH3COOC2H5

Câu 5. Một hỗn hợp A gồm 2 este đơn chức X, Y (MX < My). Đun nóng 12,5 gam hỗn hợp A với một lượng dung dịch NaOH vừa đủ thu được 7,6 gam hỗn hợp ancol no B, đơn chức có khối lượng phân tử hơn kém nhau 14 đvC và hỗn hợp hai muối Z. Đốt cháy 7,6 gam B thu được 7,84 lít khí CO2 (đktc) và 9 gam H2O. Phần trăm khối lượng của X, Y trong hỗn hợp A lần lượt là:

A. 59,2%; 40,8%      B. 50%; 50%         C. 40,8%; 59,2%        C. 66,67%; 33,33%

XÁC ĐỊNH CÔNG THỨC HÓA HỌC CỦA HỖN HỢP ESTE ĐỒNG PHÂN DỰA VÀO PHẢN ỨNG THỦY PHÂN

Câu 1. Hai este đơn chức X và Y là đồng phân của nhau. Khi hoá hơi 1,85 gam X, thu được thể tích hơi đúng bằng thể tích của 0,7 gam N2 (đo ở cùng điều kiện). Công thức cấu tạo thu gọn của X và Y là

A. HCOOC2H5 và CH3COOCH3            B. C2H3COOC2H5 và C2H5COOC2H3
C. C2H5COOCH3 và HCOOCH(CH3)2       D. HCOOCH2CH2CH3 và CH3COOC2H5

Câu 2. Thủy phân hoàn toàn hỗn hợp gồm hai este đơn chức X, Y là đồng phân cấu tạo của nhau cần 100ml dung dịch NaOH 1M, thu được 7,85 gam hỗn hợp hai muối của hai axit là đồng đẳng kế tiếp và 4,95 gam hai ancol bậc I. Công thức cấu tạo và phần trăm khối lượng của hai este là

A. HCOOCH2CH2CH3 75%, CH3COOC2H5 25%
B. HCOOC2H5 45%, CH3COOCH3 55%
C. HCOOC2H5 55%, CH3COOCH3 45%
D. HCOOCH2CH2CH3 25%, CH3COOC2H5 75%

Câu 3. Cho 35,2 gam hỗn hợp 2 etse no đơn chức là đồng phân của nhau có tỷ khối hơi đối với H2 bằng 44 tác dụng với 2 lít dd NaOH 0,4M, rồi cô cạn dd vừa thu được, ta được 44,6 gam chất rắn B. Công thức cấu tạo thu gọn của 2 este là:

A. H-COO-C2H5 và CH3COO-CH3         B. C2H5 COO-CH3 và CH3COO- C2H5
C. H-COO-C3H7 và CH3COO-C2H5        D. H-COO-C3H7 và CH3COO-CH3

Câu 5. Đun a gam hỗn hợp hai chất X và Y là đồng phân cấu tạo của nhau với 200 ml dung dịch NaOH 1M (vừa đủ) đến khi phản ứng hoàn toàn thu được 15 gam hỗn hợp 2 muối của 2 axit no, đơn chức, là đồng đẳng kế tiếp nhau và một ancol. Giá trị của a và CTCT của X, Y lần lượt là:

A. 12,0; CH3COOH và HCOOCH3         B. 14,8; HCOOC2H5 và CH3COOCH3
C. 14,8; CH3COOCH3 và CH3CH2COOH    D. 9,0; CH3COOH và HCOOCH3

Câu 6. Để xà phòng hoá hoàn toàn 52,8 gam hỗn hợp hai este no, đơn chức, mạch hở là đồng phân của nhau cần vừa đủ 600 ml dung dịch KOH 1M. Biết cả hai este này đều không tham gia phản ứng tráng bạc. Công thức của hai este là:

A. C2H5COOC2H5 và C3H7COOCH3      B. C2H5COOCH3 và CH3COOC2H5
C. HCOOC4H9 và CH3COOC3H7         D. CH3COOC2H5 và HCOOC3H7

Câu 7. Hỗn hợp X gồm hai este đơn chức là đồng phân của nhau. Đung nóng m gam X với 300 ml dd NaOH 1M, kết thúc các Pư thu được dd Y và (m – 8,4) gam hỗn hợp hơi gồm hai anđehit no, đơn chức, đồng đẳng kế tiếp có tỉ khối hơi so với H2 là 26,2. Cô cạn dd Y thu được (m – 1,1) gam chất rắn. Công thức của hai este là:

A. CH3COOCH=CHCH3 và CH3COOC(CH3)=CH2
B. HCOOC(CH3)=CH2 và HCOOCH=CHCH3
C. C2H5COOCH=CH2 và CH3COOCH=CHCH3
D. HCOOCH=CHCH3 và CH3COOCH=CH2

Câu 8. Hoá hơi 2,64 gam hỗn hợp hai este X, Y đồng phân của nhau thu được thể tích hơi bằng thể tích của 0,84 gam khí nitơ ở cùng điều kiện, nhiệt độ, áp suất. Nếu đun hỗn hợp X, Y với một lượng dung dịch NaOH dư đến khi phản ứng hoàn toàn, thu được 2,32 gam hỗn hợp hai muối của hai axit kế tiếp nhau trong dãy đồng đẳng. Công thức cấu tạo của X, Y lần lượt là:

A. HCOOC3H7 và CH3COOC2H5        B. HCOOC3H7 và HCOOC3H7
C. HCOOC3H7 và CH3COOC2H3        D. Cả A, B đều đúng

Câu 9. Xà phòng hoá hoàn toàn 2,22 gam hỗn hợp 2 este A, B là đồng phân của nhau cần dùng vừa hết 30ml dung dịch NaOH 1M. Mặt khác khi đốt cháy hoàn toàn hỗn hợp este đó thu được khí CO2 và H2O với thể tích bằng nhau (ở cùng điều kiện). Công thức cấu tạo của 2 este là

A. CH3COOCH3, HCOOC2H5           
B. CH3COOC2H5, C2H5COOCH3
C. HCOOCH2CH2CH3, HCOOCH(CH3)CH3
D. CH3COOCH=CH2, CH2=CH-COOCH3

XÁC ĐỊNH CÔNG THỨC HÓA HỌC CỦA ESTE ĐA CHỨC

1. Xác định CTHH của este khi biết dạng của este

Câu 1. X là một este đa chức tạo bởi một ancol no, mạch hở, ba chức Y và một axit Z không no, đơn chức là dẫn xuất của một olefin. Trong X cacbon chiếm 56,7% khối lượng. Công thức cấu tạo của X là:

A. (CH3CH=CHCOO)3C3H5             B. (CH2=CHCOO)3C3H5
C. [CH2=C(CH3)COO]3C3H5            D. A hoặc C

Câu 2. Este X được tạo thành từ etylen glycol và hai axit cacboxylic đơn chức. Trong phân tử este, số nguyên tử cacbon nhiều hơn số nguyên tử oxi là 1. Khi cho m gam X T/d với dd NaOH (dư) thì lượng NaOH đã Pư là 10 gam. Giá trị của m là

A. 14,5           B. 17,5              C. 15,5                 D. 16,5

Câu 3. Khi thuỷ phân a g một este X thu được 0,92g glixerol, 3,02 gam natri linoleat (C17H31COONa) và m g muối natri oleat (C17H33COONa). Giá trị của a, m lần lượt là

A. 8,82g; 6,08g     B. 7,2g; 6,08g        C. 8,82g; 7,2g            D. 7,2g; 8,82g

Câu 4. Khi xà phòng hoá 5,45 gam X có công thức phân tử C9H14O6 đã dùng 100 ml dung dịch NaOH 1 M thu được ancol no Y và muối của một axit hữu cơ. Để trung hoà lượng xút dư sau phản ứng phải dùng hết 50 ml dung dịch HCl 0,5 M. Biết rằng 23 gam ancol Y khi hoá hơi có thể tích bằng thể tích của 8 gam O2 (trong cùng điều kiện). Công thức của X là:

A. (C2H5COO)2-C3H5(OH)              B. (HCOO)3C6H11
C. C2H5COO-C2H4-COO-C2H4COOH     D. (CH3COO)3C3H5

Câu 5. X là este hai chức tác dụng với dung dịch NaOH tạo ra 1 muối và 1 ancol đều có số mol bằng số mol este, đều có cấu tạo mạch thẳng. Mặt khác 2,58 gam X tác dụng vừa đủ với 0,03 mol KOH thu được 3,33 gam muối. Tên gọi của X là:

A. etilenglicol oxalat                    B. etilenglicol ađipat
C. đimetyl malonat                     D. đimetyl ađipat

Câu 6. A là một este tạo bởi 3 chức mạch hở. Đun nóng 7,9 gam A với NaOH dư thu được 8,6 gam muối D và Ancol B. Tách nước từ B có thể thu được propenal. Cho D T/d dd H2SO4 thu được 3 axit no đơn chức mạch hỏ, trong đó 2 axit có phân tử khối nhỏ là đồng phân của nhau. CTPT của axit có phân tử khối nhỏ là

A. C5H10O2       B. C7H14O2         C. C4H8O2                D. C6H12O

Câu 7. Đun nóng 7,2 gam este X với dd NaOH dư. Pư kết thúc thu được glixerol và 7,9 gam hỗn hợp muối. Cho toàn bộ hỗn hợp muối đó T/d với H2SO4 loãng thu được 3 axit hữu cơ no, đơn chức, mạch hở Y, Z, T. Trong đó Z, T là đồng phân của nhau, Z là đồng đẳng kế tiếp của Y. CTCT của X

A. Ôn tập hóa học lớp 12 B. Bài tập este hóa học lớp 12
C. Bài tập este lớp 12 D. A hoặc B

2. Xác định dạng của este, xác định CTPT

Câu 1. Xà phòng hoá hoàn toàn 0,1 mol este X (chỉ chứa 1 loại nhóm chức) cần 0,3 mol NaOH, thu 9,2g ancol Y và 20,4g một muối Z (cho biết 1 trong 2 chất Y hoặc Z là đơn chức). Công thức của X là

A. CH3CH2OOC-COOCH2CH3          B. C3H5(OOCH)3
C. C3H5(COOCH3)3                   D. C3H5(COOCH3)3

Câu 2. Đun nóng 0,1 mol chất hữu cơ X với một lượng vừa đủ dung dịch NaOH thu được 13,4 gam muối của một axit hữu cơ Y và 9,2 gam một rượu. Cho rượu bay hơi 127°C và 600 mmHg thu được một thể tích 8,32 lít. CTCT của X là:

A. C2H5OOC COOC2H5                B. CH3OOC-COOC2H5
C. CH3OOC-CH2-COOC2H5            D. C2H5OOC CH2 COOC2H5

Câu 3. Cho 0,01 mol một este X của axit hữu cơ phản ứng vừa đủ với 100 ml dung dịch NaOH 0,2 M, sản phẩm tạo thành chỉ gồm một ancol Y và một muối Z với số mol bằng nhau. Mặt khác, khi xà phòng hoá hoàn toàn 1,29 gam este đó bằng một lượng vừa đủ là 60 ml dung dịch KOH 0,25 M, sau khi phản ứng kết thúc đem cô cạn dung dịch được 1,665 gam muối khan. Công thức của este X là:

A. C2H4(COO)2C4H8                  B. C4H8(COO)2C2H4
C. C2H4(COOC4H9)2                  D. C4H8(COO C2H5)2

Câu 4. Xà phòng hoá hoàn toàn 0,01 mol este E (có khối lượng 8,9 gam) cần dùng vừa đủ 300 ml dung dịch NaOH 0,1 M thu được một ancol và 9,18 gam muối của một axit hữu cơ đơn chức, mạch hở, có mạch cacbon không phân nhánh. Công thức của E là

A. C3H5(OOCC17H35)3.               B. C3H5(OOCC17H33)3.
C. C3H5(OOCC17H31)3.               D. C3H5(OOCC15H31)3.

3. Bài tập tổng hợp về este đa chức

Câu 1. Một este A (không chứa chức nào khác) mạch hở được tạo ra từ 1 axit đơn chức và rượu no. Lấy 2,54 gam A đốt cháy hoàn toàn thu được 2,688 lít CO2 (đktc) và 1,26 gam H2O . 0,1 mol A phản ứng vừa đủ với 12 gam NaOH tạo ra muối và rượu. Đốt cháy toàn bộ lượng rượu này được 6,72 lít CO2 (đktc). Xác định CTPT, CTCT của A

Câu 2. X là este của axit A và ancol đơn chức B. Đun nóng 32,34 g X với dung dịch NaOH dư đến khi phản ứng hoàn toàn. Cô cạn dung dịch thu được chất rắn Y và ancol B. Đun ancol B với H2SO4 đặc thu được 12,0736 lít khí Z ở 27,30C, 1 atm và dZ/B = 0,609. Nung Y với vôi tôi xút thu được 5,488 lít khí T duy nhất có tỉ khối so với hiđro bằng 8. Công thức cấu tạo của X là:

A. CH2(COOC2H5)2                  B. CH2(COOCH3)2
C. (COOC2H5)2                     D. CH3-COO-C2H5

Câu 3. Một hợp chất hữu cơ X có công thức phân tử C7H12O4. Biết X chỉ có 1 loại nhóm chức, khi cho 16 gam X tác dụng vừa đủ 200 gam dung dịch NaOH 4% thì thu được một rượu Y và 17,80 gam hỗn hợp 2 muối. Xác định công thức cấu tạo thu gọn của X.

A. CH3OOC-COOC2H5              B. CH3COO-( CH2)2-OOC2H5
C. CH3COO-(CH2)2-OOC2H5         D. Tất cả đều sai 

Câu 4. Thủy phân hòan toàn A trong 100ml dung dịch NaOH 1M rồi cô cạn dung dịch thu được 6,22 gam chất rắn khan B và một rượu C. Đun nóng rượu C với H2SO4 đặc thu được 0,04 mol olefin bé nhất. Công thức của A là:

A. CH3CH2OOC-CH(NH2)-COOCH2CH3
B. CH3CH2OOC-CH2-CH (NH2)-COOCH2CH3
C. CH3OOC-CH2CH2CH(NH2)-COOCH3
D. C2H5OOC-CH2CH2CH(NH2)-COOC2H5.

Câu 5. X là este mạch hở do axit no A và ancol no B tạo ra. Khi cho 0,2 mol X phản ứng với NaOH thu được 32,8 gam muối. Để đốt cháy 1 mol B cần dùng 2,5 mol O2. Công thức cấu tạo của X là:

A. (C2H5COO)2C2H4.               B. (HCOO)2C2H4.
C. (CH3COO)2C2H4.                D. (HCOO)3C3H5.

Đánh giá bài viết
1 6.154
Hóa học lớp 12 Xem thêm