Đề khảo sát chất lượng ôn thi THPT Quốc gia lần 1 môn Hóa học năm 2016 trường THPT Đồng Đậu

2 1.377

Đề khảo sát chất lượng ôn thi THPT Quốc gia lần 1 môn Hóa học

Nhằm chuẩn bị cho kỳ thi THPT Quốc gia năm 2016, nhiều trường đã tổ chức thi thử để kiểm tra chất lượng ôn thi tốt nghiệp, ôn thi đại học của học sinh lớp 12. VnDoc.com giới thiệu tới các bạn Đề thi thử THPT Quốc gia môn Hóa học lần 1 năm 2016 của trường THPT Đồng Đậu, Vĩnh Phúc. Mời các bạn tham khảo.

Đề thi thử THPT Quốc gia môn Vật Lý năm 2016

SỞ GD VÀ ĐT VĨNH PHÚC
TRƯỜNG THPT ĐỒNG ĐẬU
(Đề thi có 4 trang)
ĐỀ KSCL ÔN THI THPT QUỐC GIA LẦN I
Môn: HÓA HỌC
Thời gian làm bài: 90 phút, không kể thời gian phát đề

Mã đề: 134

Cho nguyên tử khối của các nguyên tố: H = 1; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; P = 31; S = 32; Cl = 35,5; K = 39; Ca = 40; Fe = 56; Cu = 64; Br = 80; Ag = 108; Cd=112; Ba = 137.

Câu 1: Este X có công thức cấu tạo thu gọn là CH3COOCH3. Tên gọi của X là

        A. metyl fomiat.         B. etyl fomiat.         C. metyl axetat.         D. etyl axetat.

Câu 2: Nguyên tử nguyên tố X có tổng số electron trong các phân lớp p là 8. Vị trí của X trong bảng hệ thống tuần hoàn là

     A. X có số thứ tự 13, chu kì 3, nhóm IIIA.         B. X có số thứ tự 14, chu kì 3, nhóm IVA.
     C. X có số thứ tự 12, chu kì 3, nhóm IIA.          D. X có số thứ tự 15, chu kì 3, nhóm VA.

Câu 3: Đun 3,0 gam CH3COOH với 4,6 gam C2H5OH dư (xúc tác H2SO4 đặc), thu được m gam CH3COOC2H5. Biết hiệu suất của phản ứng este hoá đạt 50 %. Giá trị của m là

           A. 1,1.              B. 2,2.                  C. 4,4.               D. 8.8.

Câu 4: Đốt cháy hoàn toàn 0,1 mol hỗn hợp X gồm 2 axit cacboxylic đồng đẳng kế tiếp thu được 6,16 gam CO2 và 2,52 gam H2O. Công thức của 2 axit là:

        A. CH3COOH và C2H5COOH.          B. C2H3COOH và C3H5COOH.

       C. HCOOH và CH3COOH.             D. C2H5COOH và C3H7COOH.

Câu 5: Khẳng định nào sau đây không đúng?

A. Khí NH3 dễ hoá lỏng, dễ hoá rắn, tan nhiều trong nước.

B. Trong điều kiện thường, NH3 là khí không màu, mùi khai và xốc.

C. Liên kết giữa N và 3 nguyên tử H là liên kết cộng hoá trị có cực.

D. Khí NH3 nặng hơn không khí .

Câu 6: Phát biểu nào sau đây không đúng?

A. Có thể phân biệt glucozơ và fructozơ bằng phản ứng tráng bạc.

B. Glucozơ và fructozơ là đồng phân cấu tạo của nhau.

C. Khi thủy phân hoàn toàn tinh bột thì không thu được fructozơ.

D. Phân tử xenlulozơ được cấu tạo từ các gốc glucozơ.

Câu 7: Khử hoàn toàn m gam Fe2O3 cần vừa đủ 3,36 lít khí CO (ở đktc). Khối lượng sắt thu được sau phản ứng là

           A. 8,4.               B. 5,6.              C. 2,8.           D. 16,8.

Câu 8: Lưu huỳnh trong chất nào sau đây vừa có tính oxi hóa, vừa có tính khử?

        A. H2SO4.             B. SO2.              C. H2S.         D. Na2SO4.

Câu 9: Cho 0,2 mol một anđehit đơn chức, mạch hở X phản ứng vừa đủ với 300 ml dung dịch chứa AgNO3 2M trong NH3. Sau khi phản ứng xảy ra hoàn toàn thu được 87,2 g kết tủa. Công thức phân tử của anđehit là:

        A. C3H3CHO            B. C4H5CHO            C. C3H5CHO.          D. C4H3CHO

Câu 10: Dung dịch X chứa 0,6 mol NaHCO3 và 0,3 mol Na2CO3. Thêm rất từ từ dung dịch chứa 0,8 mol HCl vào dung dịch X được dung dịch Y và V lít khí CO2 đktc. Thêm vào dung dịch Y nước vôi trong dư thấy tạo thành m gam kết tủa. Tính thể tích V và khối lượng m..

            A. 11,2 lít CO2 ; 40 gam CaCO3.           B. 11,2 lít CO2 ; 90 gam CaCO3

            C. 16,8 lít CO2 ; 60 gam CaCO3           D. 11,2 lít CO2 ; 60 gam CaCO3.

Câu 11: Đốt cháy hoàn toàn 0,88 gam 2 este đồng phân thu được 1,76 gam CO2 và 0,72 gam H2O. Công thức phân tử của 2 este là:

         A. C5H10O2.          B. C4H6O2.         C. C3H6O2.        D. C4H8O2.

Câu 12: Một loại phân kali có chứa 87% K2SO4 còn lại là các tạp chất không chứa kali, độ dinh dưỡng của loại phân bón này là:
        A. 44,8%.           B. 54,0%.        C. 39,0%.         D. 47,0%.

Câu 13: Trong phòng thí nghiệm, người ta thường điều chế Clo bằng cách

A. Cho dung dịch HCl đặc tác dụng với MnO2, đun nóng.

B. Cho F2 đẩy Cl2 ra khỏi dung dịch NaCl.

C. Điện phân nóng chảy NaCl.

D. Điện phân dung dịch NaCl có màng ngăn

Câu 14: Hỗn hợp X gồm metyl metacrylat, axit axetic, axit benzoic. Đốt cháy hoàn toàn a gam X sinh ra 0,38 mol CO2 và 0,29 mol H2O. Khi lấy a gam X phản ứng vừa đủ với dung dịch NaOH thu được 0,01 mol ancol và m gam muối. Giá trị của m là:

         A. 12,02.               B. 25,00.               C. 12,16.                 D. 11,75

Câu 15: Hình vẽ bên mô tả thí nghiệm nào

Đáp án môn hóa THPT

A. Chứng minh khả năng tan tốt trong nước của khí NH3.

B. Chứng minh khả năng tan tốt trong nước của khí CO2.

C. Chứng minh khả năng tan tốt trong nước của khí HCl.

D. Chứng minh khả năng tan tốt trong nước của phenolphtalein

Câu 16: Số lượng đồng phân ứng với công thức phân tử C3H5Br3 là:

           A. 3.            B. 4.             C. 5.           D. 6.

Câu 17: Đốt cháy hoàn toàn 6,2 gam photpho bằng oxi dư rồi cho sản phẩm tạo thành tác dụng vừa đủ với m gam dung dịch NaOH 32% thu được muối Na2HPO4. Giá trị của m là:

            A. 75.              B. 50.           C. 100.             D. 25.

Câu 18: Cho công thức cấu tạo sau: CH3-CH(OH)-CH=C(Cl)-CHO. Số oxi hóa của các nguyên tử cacbon tính từ phải sang trái có giá trị lần lượt là

    A. +1; -1; 0; -1; +3.         B. +1; +1; -1; 0; -3.         C. +1; -1; -1; 0; -3.     D. +1; +1; 0; -1; +3.

Câu 19: Hòa tan hoàn toàn 1,6 gam Cu bằng dung dịch HNO3, thu được x mol NO2 (là sản phẩm khử duy nhất của N+5). Giá trị của x là

          A. 0,05.           B. 0,15.            C. 0,25.               D. 0,10.

Câu 20: Hỗn hợp X chứa Na2O, NH4Cl, NaHCO3 và BaCl2 có số mol mỗi chất đều bằng nhau. Cho hỗn hợp X vào nước (dư), đun nóng, dung dịch thu được chứa:

            A. NaCl, NaOH, BaCl2.                      B. NaCl, NaOH.

            C. NaCl, NaHCO3, NH4Cl, BaCl2.               D. NaCl.

Câu 21: Đun nóng 18 gam glucozơ với dung dịch AgNO3/NH3 dư thì thu được m gam Ag. Giá trị của m là

        A. 7,20.                B. 2,16.          C. 10,8.          D. 21,6.

Câu 22: Có 4 axit: HCl; HBr; HF; HI. Tính khử tăng dần theo thứ tự:

     A. HBr; HF; HI;HCl         B. HCl; HI; HBr; HF         C. HI; HBr; HCl; HF          D. HF; HCl; HBr; HI

Câu 23: Loại đường nào sau đây có nhiều trong cây mía:

         A. fructozơ.            B. glucozơ.         C. mantozơ.      D. saccarozơ.

Câu 24: Cấu hình electron phân lớp ngoài cùng của X2- là 3p6. Vậy X thuộc:

           A. Chu kì 2, nhóm VIA.             B. Chu kì 3, nhóm VIIIA.

           C. Chu kì 3, nhóm VIA.             D. Chu kì 2, nhóm VIIIA.

Câu 25: Số đồng phân là hợp chất thơm có công thức phân tử C8H10O tác dụng được với NaOH là:

             A. 7.              B. 8.             C. 6.          D. 9.

Câu 26: Đốt cháy hoàn toàn m gam Fe trong khí Cl2 dư, thu được 6,5 gam FeCl3. Giá trị của m là

              A. 2,80.              B. 2,24.         C. 1,12.         D. 0,56.

Câu 27: Hợp chất CH3-C(CH3)=CH-C(CH3)2-CH=CH-Br có danh pháp IUPAC là

           A. 3,3,5-trimetyl hexa-1,4-đien-1-brom.        B. 1-brom-3,3,5-trimetyl hexa-1,4-đien.

           C. 1-brom-3,5-trimetyl hexa-1,4-đien.          D. 3,3,5-trimetyl hexa-1,4-đien-1-brom.

Câu 28: Khi đun nóng hỗn hợp gồm glixerol và 2 axit béo RCOOH và R'COOH có thể thu được tối đa bao nhiêu loại chất béo (tri glixerit)?

          A. 6                B. 4               C. 5              D. 3

Câu 29: Dung dịch nào sau đây làm phenolphtalein chuyển sang màu hồng

         A. NH4NO3.           B. NaOH.        C. NaCl.              D. HCl.

Câu 30: Cân bằng nào sau đây chuyển dịch theo chiều thuận khi tăng áp suất?

A. CaCO3(rắn) ↔ CaO(rắn) + CO2(khí)                 B. H2(khí) + I2(khí)   2HI (khí)

C. N2(khí) + 3H2(khí)   2NH3(khí)                D. S(rắn) + H2(khí)  H2S(khí)

Câu 31: Hấp thụ hoàn toàn 4,48 lit khí SO2 (ở đktc) vào 500ml dung dịch hỗn hợp gồm NaOH 0,1M và Ba(OH)2 0,2 M, sinh ra m gam kết tủa. Giá trị của m là:

         A. 11,6              B. 17,7           C. 21,7           D. 10,85

Câu 32: Methadone là một loại thuốc dùng trong cai nghiện ma túy, nó thực chất cũng là một loại chất gây nghiện nhưng "nhẹ" hơn các loại ma túy thông thường và dễ kiểm soát hơn. Công thức cấu tạo của nó như hình bên. Hãy cho biết CTPT của nó?

Đề thi THPT quốc gia môn hóa

         A. C17H22NO.                  B. C21H29NO.

         C. C21H27NO.                  D. C17H27NO.

Câu 33: Thuỷ phân 62,5 gam dung dịch saccarozơ 17,1% trong môi trường axit (vừa đủ) được dung dịch X. Cho dung dịch AgNO3/NH3 vào X và đun nhẹ được m gam Ag, biết các phản ứng xảy ra hoàn toàn giá trị của m là:

          A. 13,5.          B. 7,5.          C. 6,75.          D. 10,8.

Câu 34: Hỗn hợp X gồm M2CO3, MHCO3 và MCl (M là kim loại kiềm). Cho 32,65 gam X tác dụng vừa đủ với dung dịch HCl thu được dung dịch Y và có 17,6 gam CO2 thoát ra. Dung dịch Y tác dụng với dung dịch AgNO3 dư được 100,45 gam kết tủa. Kim loại M là:

          A. Li.           B. Na.         C. K.        D. Rb.

Câu 35: Cho các phản ứng sau:

(1) Fe(OH)2 + H2SO4 đặc  →                           (2) Fe + H2SO4 loãng   →  

(3) Fe(OH)3 + H2SO4 đặc  →                           (4) Fe3O4 + H2SO4 loãng   →  

(5) Cu + H2SO4 loãng + dung dịch NaNO3                 (6) FeCO3 + H2SO4 đặc  →  

Số phản ứng hóa học trong đó H2SO4 đóng vai trò là chất oxi hóa là

       A. 2.              B. 4             C. 3.             D. 5.

Câu 36: Hỗn hợp X gồm 2 este đơn chức A và B hơn kém nhau một nhóm -CH2- Cho 6,6g hỗn hợp X tác dụng vừa đủ với 100ml dung dịch NaOH 1M thu được 7,4g hỗn hợp 2 muối. Công thức cấu tạo chính xác của A và B là

     A. CH3-COOC2H5 và H-COOC2H5           B. CH3-COO-CH=CH2 và H-COO-CH=CH2

     C. CH3-COOC2H5 và CH3-COOCH3          D. H-COOCH3 và CH3-COOCH3

Câu 37: Đốt cháy hoàn toàn một hợp chất hữu cơ X (C, H, N) bằng lượng không khí vừa đủ (gồm 1/5 thể tích O2, còn lại là N2) được khí CO2, H2O và N2. Cho toàn bộ sản phẩm cháy qua bình đựng dung dịch Ba(OH)2 dư thấy có 39,4 gam kết tủa, khối lượng dung dịch giảm đi 24,3 gam. Khí thoát ra khỏi bình có thể tích 34,72 lít (đktc). Biết < 2. CTPT của X là

       A. C2H7N.            B. C3H9N.           C. C3H6N2.         D. C2H4N2.

Câu 38: Hoà tan hoàn toàn 11,2g kim loại Fe trong 300ml dung dịch HNO3 2M, sau khi các phản ứng xảy ra hoàn toàn thấy có khí NO (duy nhất) thoát ra. Cô cạn dung dịch sau phản ứng ta thu được chất rắn khan có khối lượng là
       

      A. 36,3gam.            B. 48,4gam.          C. 39,1gam           D. 36gam

Câu 39: Trong các chất có đồng phân cấu tạo CH3-CH=CH2, CH3-CH=CHCl, CH3-CH=C(CH3)2, C6H5CH=CH-CH3. Số chất có đồng phân hình học là:
         A. 1.            B. 4.           C. 2.        D. 3.

Câu 40: Lên men m gam glucozơ với hiệu suất 80% thu được 44,8 lít khí CO2 (ở đktc) và V lít ancol etylic 23o (biết khối lượng riêng của C2H5OH là 0,8 gam/ml). Giá trị m và V lần lượt là:

        A. 225 và 0,5.         B. 225 và 0,32.          C. 450 và 0,5.            D. 144 và 0,32.

Câu 41: Chất nào sau đây là một phi kim

            A. S.              B. Ne.             C. Al.                D. Fe.

Câu 42: Dẫn 0,5 mol hỗn hợp khí gồm H2 và CO có tỉ khối so với H2 là 4,5 qua ống đựng 0,4 mol Fe2O3 và 0,2 mol CuO đốt nóng. Sau phản ứng hoàn toàn cho chất rắn trong ống vào dung dịch HNO3 loãng, dư thu được V lít khí NO (sản phẩm khử duy nhất, ở đktc). Giá trị của V là:

           A. 20,907.            B. 3,730             C. 34,720.          D. 7,467.

Câu 43: Oxi hóa 9,2 gam ancol etylic bằng CuO đun nóng, thu được 13,2 gam hỗn hợp gồm anđehit, axit, ancol chưa phản ứng và nước Hỗn hơp này tác dụng với Na dư sinh ra 3,36 lít H2 ở đktc Phần trăm khối lượng ancol đã chuyển hóa thành axít là:

       A. 90%.            B. 75%.            C. 50%.          D. 25%.

Câu 44: Khi xà phòng hóa triolein bằng dung dịch NaOH ta thu được sản phẩm là

        A. C17H33COONa và glixerol.            B. C15H31COONa và glixerol.

        C. C17H33COONa và etanol.             D. C17H33COOH và glixerol.

Câu 45: Giữa saccarozơ và glucozơ có đặc điểm giống nhau là

A. đều được chiết xuất từ củ cải đường.

B. đều có phản ứng thủy phân trong môi trường axit.

C. đều bị oxi hóa bởi AgNO3 trong NH3

D. đều hòa tan được Cu(OH)2 ở nhiệt độ thường cho dung dịch màu xanh lam

Câu 46: Khi nhiệt độ tăng thêm 10oC tốc độ phản ứng tăng lên 3 lần. Để tốc độ phản ứng đó (đang tiến hành ở 30oC ) tăng lên 81 lần, cần phải thức hiện ở nhiệt độ nào sau đây?

         A. 30oC              B. 70oC         C. 10oC       D. 270oC

Câu 47: Hỗn hợp M gồm vinyl axetilen và hiđrocacbon X mạch hở. Khi đốt cháy hoàn toàn một lượng M thu được số mol nước gấp đôi số mol của M. Mặt khác dẫn 8,96 lít M (ở đktc) lội từ từ qua nước brom dư, đến phản ứng hoàn toàn thấy có 2,24 lít khí thoát ra (ở đktc). Phần trăm khối lượng của X trong M là:

         A. 27,1%.          B. 9,3%.             C. 40,0%.         D. 25,0%.

Câu 48: Hỗn hợp X gồm C2H2 và H2 có cùng số mol. Lấy một lượng hỗn hợp X cho qua chất xúc tác nung nóng, thu được hỗn hợp Y gồm C2H4, C2H6, C2H2 và H2. Sục Y vào dung dịch brom (dư) thì khối lượng bình brom tăng 10,8 gam và thoát ra 4,48 lít hỗn hợp khí (đktc) có tỉ khối so với H2 là 8. Thể tích O2 (đktc) cần để đốt cháy hoàn toàn hỗn hợp Y là

         A. 22,4 lít.           B. 44,8 lít.           C. 33,6 lít.         D. 26,88 lít.

Câu 49: Trong các chất sau đây, chất nào có nhiệt độ sôi cao nhất?

       A. CH3CH3.            B. CH3COOH.          C. CH3CH2OH.          D. CH3CHO.

Câu 50: Số lượng đồng phân este ứng với công thức phân tử C4H8O2 là:

       A. 2.                   B. 3.              C. 4.             D. 5.

Đáp án đề thi thử THPT Quốc gia môn Hóa học năm 2016

1. C 11. D 21. D 31. D 41. A
2. B 12. D 22. D 32. C 42. D
3. B 13. A 23. D 33. A 43. C
4. C 14. D 24. C 34. A 44. A
5. D 15. A 25. D 35. C 45. D
6. A 16. C 26. B 36. D 46. B
7. B 17. B 27. B 37. A 47. B
8. B 18. B 28. A 38. C 48. C
9. D 19. A 29.B 39. C 49. B
10. A 20. D 30. C 40. A 50. C
Đánh giá bài viết
2 1.377
Thi THPT Quốc Gia Xem thêm