Giải bài tập Hóa 11 Bài 46: Luyện tập Anđehit - Xeton - Axit cacboxylic

VnDoc mời bạn đọc tham khảo tài liệu Giải bài tập Hóa 11 Bài 46: Luyện tập Anđehit - Xeton - Axit cacboxylic, hy vọng qua bộ tài liệu các bạn học sinh sẽ rèn luyện giải bài tập Hoá học 11 một cách hiệu quả nhất. Mời thầy cô cùng các bạn học sinh tham khảo.

Bài 1 trang 212 SGK Hóa 11

Điền Đ (đúng) hoặc S ( sai) vào ô vuông bên cạnh các câu sau:

a) Anđehit vừa có tính khử vừa có tính oxi hóa.

b) Anđehit là hợp chất lưỡng tính.

c) Khi tác dụng với hiđro có xúc tác Ni, anđehit chuyển thành ancol bậc I.

d) Axit axetic tác dụng được với dung dịch bazơ, oxit bazơ, muối cacbonat và kim loại đứng trước hiđro trong dãy hoạt động hóa học của kim loại.

e) Oxi hóa không hoàn toàn ancol bậc II thu được xeton.

f) Trong công nghiệp, axeton được tổng hợp từ cumen.

Đáp án hướng dẫn giải 

a) Đ

b) S

c) Đ

d) Đ

e) Đ

f) S

Bài 2 trang 212 SGK Hóa 11

Trình bày phương pháp hóa học để phân biệt các dung dịch: anđehit axetic, axit axetic, glixerol, ancol etylic.

Đáp án hướng dẫn giải 

CH3CHOCH3COOHC3H5(OH)3C2H5OH
NaKhông hiện tượngKhí H2Khí H2Khí H2
CaCO3xKhí CO2Không hiện tượngKhông hiện tượng
Cu(OH)2xxDung dịch xanh lamKhông hiện tượng

Phương trình hóa học 

2CH3COOH + 2Na → 2CH3COONa + H2

2C3H5(OH)3 + 6Na → 2C3H5(ONa)3 + 3H2

2C2H5OH + 2Na → 2C2H5ONa + H2

CH3COOH + CaCO3 → (CH3COO)2Ca +CO2 + H2O

2C3H5(OH)3 + Cu(OH)2 → [C3H5(OH)2O]2Cu + H2O

Bài 3 trang 212 SGK Hóa 11

Dẫn hỗn hợp khí X gồm axetilen và anđehit axetic vào dung dịch AgNO3 trong ammoniac thấy tạo ra kết tủa gồm hai chất. Lấy kết tủa cho vào dung dịch axit HCl dư thấy có khí bay lên và còn một phần không tan Y. Hòa tan Y trong dung dịch HNO3 đặc thấy có khí màu nâu bay lên. Viết phương trình hóa học của các phản ứng xảy ra để giải thích quá trình thí nghiệm trên.

Đáp án hướng dẫn giải 

C2H2 + 2AgNO3 + 2NH3 → C2Ag2 ↓ + 2NH4NO3

CH3CHO + 2AgNO3 + 3NH3 + H2O → CH3COONH4 + 2Ag ↓ + 2NH4NO3

Lọc kết tủa: C2Ag2 và Ag cho vào HCl chỉ có C2Ag2 phản ứng:

C2Ag2 + 2HCl → 2AgCl ↓ + C2H2

Phần không tan Y là AgCl và Ag, hòa tan trong HNO3 đặc chỉ có Ag phản ứng

Ag + 2HNO3 → AgNO3 + NO2 ↑ (màu nâu) + H2O

AgCl không tan trong HNO3

Bài 4 trang 213 SGK Hóa 11

Cho 1 gam axit axetic vào ống nghiệm thứ nhất và 1 gam axit fomic vào ống nghiệm thứ hai, sau đó cho vào cả hai ống nghiệm trên một lượng dư bột CaCO3. Đến khi phản ứng xảy ra hoàn toàn thì thể tích khí CO2 thu được (đo ở cùng điều kiện) thoát ra:

A. Từ hai ống nghiệm là bằng nhau.

B. Từ ống nghiệm thứ nhất nhiều hơn ống nghiệm thứ hai.

C. Từ ống nghiệm thứ hai nhiều hơn ống nghiệm thứ nhất.

D. Từ mỗi ống nghiệm đều lớn hơn 2,24 lít (đktc).

Đáp án hướng dẫn giải 

2CH3COOH + CaCO3→ (CH3COO)2Ca + CO2 + H2O  (1)

2HCOOH + CaCO3 → (HCOO)2Ca + CO2 + H2O (2)

Ta có: nCH3COOH= 1/60 mol

Theo phương trình (1): nCO2(1) = 1/2.nCH3COOH =1/2.1/60 (mol)

Ta có: nHCOOH = 1/46(mol)

Theo phương trình (2): nCO2(2)=1/2.nHCOOH = 1/2.1/46(mol)

Vậy số mol CO2 thoát ra từ ống nghiệm hai nhiều hơn ống nghiệm thứ nhất.

Bài 5 trang 213 SGK Hóa 11

Hỗn hợp A có khối lượng 10,0 gam gồm axit axetic và anđehit axetic. Cho A tác dụng với lượng dư AgNO3 trong dung dịch ammoniac thấy có 21,6 gam Ag kết tủa. Để trung hòa A cần V ml dung dịch NaOH 0,2M

a. Viết phương trình hóa học của các phản ứng xảy ra.

b. Tính thành phần phần trăm khối lượng của mỗi chất trong A và tính thể tích dung tích NaOH đã dùng.

Đáp án hướng dẫn giải 

CH3CHO + 2AgNO3 + 3NH3 + H2O → CH3COONH4 + 2Ag↓ + 2NH4NO3 (1)

CH3COOH + Na → CH3COONa + H2O (2)

Theo (1):

nCH3CHO = 1/2nAg = 0,2/2 = 0,1 mol

=> mCH3CHO = 0,1.44 = 4,4 gam

%CH3CHO = 4,4/10.100% = 44%

=> %CH3COOH = 100% - 44% = 56%

mCH3COOH = 5,6/60 = 0,0933 mol

Theo (2): nNaOH = mCH3COOH = 0,0933 (mol)

VNaOH = 0,0933/0,2 = 0,46 M

Bài 6 trang 213 SGK Hóa 11

Viết phương trình hóa học của các phản ứng hoàn thành dãy chuyển hóa sau:

Giải hóa 11 bài 46

Đáp án hướng dẫn giải

(1) CH2=CH−CH3 + H2O \overset{H^{+ } }{\rightarrow} CH3−CHOH−CH3

(2) CH3−CHOH−CH3 + CuO \overset{t^{\circ  } }{\rightarrow} CH3−CO−CH3 + Cu + H2O

(3) CH2=CH−CH3 + Cl2 \overset{as}{\rightarrow} CH2=CH−CH2Cl + HCl

(4) CH2=CH−CH2Cl + NaOH\overset{t^{\circ } }{\rightarrow} CH2=CH−CH2OH + NaCl

(5) CH2=CH−CH2OH + CuO \overset{t^{\circ } }{\rightarrow} CH2=CH−CHO + Cu + H2O

Bài 7 trang 213 SGK Hóa 11

Hợp chất X có công thức phân tử C3H6O tác dụng với một lượng dư AgNO3 trong dung dịch NH3. Công thức nào sau đây là công thức cấu tạo của X?

Bài 7 trang 213 sgk Hóa 11

Đáp án hướng dẫn giải 

Đáp án D.

Vì X tác dụng với AgNO3 trong NH3 nên X phải là anđehit.

Bài 8 trang 213 SGK Hóa 11

Cho dung dịch chứa 0,58 gam chất hữu cơ X tác dụng với một lượng dư AgNO3 trong dung dịch NH3 thu được 2,15 gam kết tủa. Xác định công thức phân tử, viết công thức cấu tạo và gọi tên của hợp chất X?

Đáp án hướng dẫn giải 

Hợp chất X đơn chức tác dụng được với AgNO3/NH3 thu được bạc kết tủa nên X là anđehit đơn chức.

Gọi công thức phân tử của X là R-CHO

RCHO + 2AgNO3 + 3NH3 + H2O → RCOONH4 + 2Ag↓ + 2NH4NO3

Theo phương trình:

nAg = 0.02 mol => nRCHO = 1/2nAg = 0,01 mol

MRCHO = 0,58: 0,01 = 58,0 g/mol.

=> R + 29 = 58

=> R = 29 (C2H5 )

CTCT của X là: CH3-CH2-CHO (propanal)

Bài 9 trang 213 SGK Hóa 11

Axit fomic tác dụng với AgNO3 trong dung dịch NH3 tạo ra kết tủa bạc kim loại. Dựa vào cấu tạo phân tử của axit fomic để giải thích, viết phương trình hóa học của phản ứng.

Đáp án hướng dẫn giải 

Bài 9 trang 213 sgk hóa 11

HCOOH + 2AgNO3 + 4NH3 + H2O → (NH4)2CO3 + 2Ag + 2NH4NO3

Bài 10 trang 213 SGK Hóa 11

Dẫn hơi của 3 gam etanol vào trong ống sứ nung nóng chứa bột CuO dư. Làm lạnh để ngưng tụ sản phẩm hơi đi ra khỏi ống sứ được chất lỏng A. Khi A phản ứng hoàn toàn với một lượng dư dung dịch AgNO3 trong NH3 thấy có 8,1 gam bạc kết tủa.

Tính hiệu suất của quá trình oxi hóa etanol?

Đáp án hướng dẫn giải 

Phương trình phản ứng:

CH3CH2OH + CuO → CH3CHO + Cu+ H2O (1)

CH3CHO + 2AgNO3 + 3NH3 + H2O → CH3COONH4 + 2Ag + 2NH4NO3 (2)

nCH3CHO = 1/2.nAg = 1/2. 8,1/108 = 0,0375 mol.

nC2H5OH pư = nCH3CHO = 0,0375 (mol)

=> mC2H5OH pư= 0,0375.46 = 1,725 (g)

Hiệu suất của phản ứng oxi hóa etanol :

%H = mC2H5OHpu/mC2H5OHbd.100%=1,725/3.100% = 57,5%

-------------------------------------

Trên đây VnDoc.com đã giới thiệu tới bạn đọc tài liệu: Giải bài tập Hóa 11 Bài 46: Luyện tập Anđehit - Xeton - Axit cacboxylic. Để có kết quả cao hơn trong học tập, VnDoc xin giới thiệu tới các bạn học sinh tài liệu Hóa học lớp 10, Giải bài tập Hóa học lớp 11, Thi thpt Quốc gia môn Văn, Thi thpt Quốc gia môn Lịch sử, Thi thpt Quốc gia môn Địa lý, Thi thpt Quốc gia môn Toán, đề thi học kì 1 lớp 11, đề thi học kì 2 lớp 11 mà VnDoc tổng hợp và đăng tải.

Để tiện trao đổi, chia sẻ kinh nghiệm giảng dạy và học tập môn học THPT, VnDoc mời các bạn truy cập nhóm riêng dành cho lớp 11 sau: Nhóm Tài liệu học tập lớp 11 để có thể cập nhật được những tài liệu mới nhất.

Đánh giá bài viết
2 2.367
0 Bình luận
Sắp xếp theo
Giải bài tập Hóa học lớp 11 Xem thêm