Bài tập thủy phân Peptit và Protein

1 132

Chuyên đề Hóa học 12 Bài tập thủy phân Peptit và Protein. Hy vọng qua bộ tài liệu sẽ giúp các bạn giải Hóa học 12 chính xác hơn. Mời các bạn tham khảo.

Phản ứng thủy phân:

- Điều kiện thủy phân: xúc tác axit hoặc kiềm và đun nóng hoặc xúc tác enzim

- Sản phẩm: các α-amino axit

I. Thủy phân hoàn toàn

1. Thủy phân trong môi trường trung tính (xt: enzym)

Khi thủy phân hoàn toàn peptit (hoặc protein đơn giản) bằng xúc tác enzym, ta thu được hỗn hợp các ∝-amino axit ban đầu.

Bài tập thủy phân Peptit và Protein

Ví dụ: Gly-Gly-Gly + 2H2O → 3H2N-CH2-COOH

Phương pháp giải:

1/ npeptit + n_{H_2O} = n α-amino axit

2/ mpeptit + m_{H_2O} = m α-amino axit

2. Thủy phân trong môi trường axit

Peptit (n mắt xích) + (n – 1)H2O + aHCl → n muối của ∝-amino axit

(với a là số nguyên tử N trong X)

Ví dụ: Gly-Gly-Lys + 2H2O + 4HCl → 2ClH3N-CH2-COOH + ClH3N-[CH2]4-CH(NH3Cl)-COOH

Phương pháp giải:

+ Tính số mol các chất theo hệ số cân bằng sau đó sử dụng bảo toàn khối lượng:

mpeptit + m_{H_2O} + mHCl = mmuối

+ Bảo toàn gốc ∝-amino axit:

Ví dụ với phương trình trên:

n_{ClH_3N-CH_2-COOH} = 2.ngly-gly-lysn_{ClH_3N-(CH_2)_4-CH(NH_3Cl)-COOH} = ngly-gly-lys

3. Thủy phân trong môi trường kiềm

Peptit (n mắt xích) + (n - 1 + b)NaOH → n muối của ∝-amino axit + bH2O

Trong đó: b là tổng số nhóm COOH còn tự do trong peptit (các nhóm COOH không tạo liên kết peptit)

Ví dụ: Gly-Glu-Gly có CTCT:

Bài tập thủy phân Peptit và Protein

→ số nhóm COOH còn tự do trong peptit là b = 2

PTHH: Gly-Glu-Gly + 4NaOH → 2H2N-CH2-COONa + NaOOC-[CH2]2-CH(NH2)-COONa + 2H2O

Phương pháp giải:

+ Tính số mol các chất theo hệ số cân bằng sau đó sử dụng bảo toàn khối lượng: mpeptit + mNaOH = mmuối + m_{H_2O}

+ Bảo toàn gốc ∝-amino axit

II. Thủy phân không hoàn toàn

Khi thủy phân không hoàn toàn peptit thì chúng ta thu được hỗn hợp các amino axit và các oligopeptit.

Ví dụ: Thủy phân không hoàn toàn Ala-Gly-Gly-Ala-Glu ta có thể thu được hỗn hợp các chất gồm Ala, Glu, Gly, Gly-Ala- Glu, Ala-Gly-Gly, …

+ Bảo toàn mắt xích của mỗi loại amino axit.

Phương pháp giải:

Ví dụ: nAla-Ala-Gly = nGly = ½.nAla

+ Bảo toàn khối lượng.

Ví dụ minh họa

Ví dụ 1: Thủy phân hết hỗn hợp gồm m gam tetrapeptit Ala-Gly-Ala-Gly (mạch hở) thu được hỗn hợp gồm 21,7 gam Ala-Gly-Ala, 7,5 gam Gly và 14,6 gam Ala-Gly. Giá trị cuả m là

Giải

Gọi số mol của tetrapeptit Ala-Gly-Ala-Gly là x

Bài tập thủy phân Peptit và Protein

Bảo toàn nhóm Ala → 2x = 0,1 .2 + 0,1 → x = 0,15

→ mX = 0,15.(89.2+75.2-3.18) = 41,1 gam.

Ví dụ 2: Thủy phân m gam pentapeptit A có công thức Gly-Gly-Gly-Gly-Gly thu được hỗn hợp B gồm 0,3 gam Gly; 0,792 gam Gly-Gly; 1,701 gam Gly-Gly-Gly; 0,738 gam Gly-Gly-Gly-Gly và 0,303 gam Gly-Gly-Gly-Gly-Gly. Giá trị của m là bao nhiêu?

Giải

B chứa:

Bài tập thủy phân Peptit và Protein

Bảo toàn Gly:

5nA = 0,004 + 0,006.2 + 0,009.3 + 0,003.4 + 0,001.5

→ nA = 0,012 mol

→ mA = 0,012.(75.5 - 18.4) = 3,636 gam

Ví dụ 3: Thủy phân hoàn toàn 143,45 gam hỗn hợp A gồm hai tetrapeptit thu được 159,74 gam hỗn hợp X gồm các Aminoaxit (Các Aminoacid chỉ chứa 1nhóm -COOH và 1 nhóm -NH2). Cho tòan bộ X tác dụng với dung dịch HCl dư, sau đó cô cạn dung dịch thì nhận được m(gam) muối khan. Tính khối lượng nước phản ứng và giá trị của m lần lượt bằng?

A. 8,145(g) và 203,78(g).

B. 32,58(g) và 10,15(g).

C. 16,2(g) và 203,78(g)

D. 16,29(g) và 203,78(g).

Giải:

Đặt Công thức chung cho hỗn hợp A là H[NHRCO]4OH

Ta có phản ứng: H[NHRCO]4OH + 3H2O → 4H2NRCOOH

Bài tập thủy phân Peptit và Protein

III. Bài tập vận dụng thủy phân Peptit và Protein

Câu 1: Thủy phân không hoàn toàn pentapeptit mạch hở: Gly-Ala-Gly-Ala-Gly có thể thu được tối đa bao nhiêu đipeptit?

A. 1

B. 2

C. 3

D. 4

Thủy phân không hoàn toàn Gly-Ala-Gly-Ala-Gly thu được 2 đipeptit khác nhau (Gly Ala và Ala-Gly).

→ Đáp án B

Câu 2: Thủy phân hoàn toàn 14,6g Gly-Ala trong dung dịch HCl dư, thu được m gam muối. Giá trị của m là:

A. 11,15g

B. 12,55g

C. 18,6gam

D. 23,7 gam.

Công thức Gly- Ala: H2NCH2CONHCH(CH3)COOH.

M Gly-Ala= MGly + Mala – 18.(2-1) = 75 + 89 -18 = 146

Bài tập thủy phân Peptit và Protein

Ta có m muối = mpeptit +m_{H_2O} + mHCl= 14,6 + 0,1.18 + 0,2. 36,5 = 23,7 g

→ Đáp án D

Câu 3: Đun nóng m gam hỗn hợp gồm a mol tetrapeptit mạch hở X và 2a mol tripeptit mạch hở Y với 600 ml dung dịch NaOH 1M (vừa đủ). Sau khi các phản ứng kết thúc, cô cạn dung dịch thu được 72,48 gam muối khan của các amino axit đều có một nhóm –COOH và một nhóm –NH2 trong phân tử. Giá trị của m là

A. 54,30.

B. 66,00.

C. 44,48.

D. 51,72.

Do X, Y tạo thành từ các amino axit có 1 nhóm -COOH và 1 nhóm -NH2, nên:

X + 4NaOH → muối + H2O

a mol 4a mol a mol

Y + 3NaOH → muối + H2O

2a mol 6a mol 2a mol

nNaOH = 10a = 0,6 mol → a = 0,06 mol

Bảo toàn khối lượng:

m + mNaOH = mmuối + m_{H_2O}

→ m + 0,6.40 = 72,48 + 18.3.0,06 → m = 51,72 gam.

→ Đáp án D

Câu 4: Cho 24,36 gam tripeptit mạch hở Gly-Ala-Gly tác dụng với lượng dung dịch HCl vừa đủ, sau phản ứng thu được dung dịch Y chứa m gam muối. Giá trị m là:

A. 37,50 gam

B. 41,82 gam

C. 38,45 gam

D. 40,42 gam

nGly-Ala-Gly = 0,12 mol

Vì Glyxin và Alanin đều chứa 1 nhóm -NH2 trong phân tử nên ta có:

Gly-Ala-Gly + 3HCl + 2H2O → muối

0,12 0,36 0,24

BTKL: mmuối = mGly-Ala-Gly + mHCl + m_{H_2O}= 24,36 + 36,5.0,36 + 18.0,24 = 41,82 gam.

→ Đáp án B

Câu 5: Thủy phân hoàn toàn 32,55 gam tripeptit mạch hở (Ala-Gly-Ala) bằng dung dịch NaOH (vừa đủ), sau phản ứng thu được dung dịch X. Cô cạn X thu được m gam muối khan. Giá trị m là:

A. 47,85 gam

B. 42,45 gam

C. 35,85 gam

D. 44,45 gam

nAla-Gly-Ala = 0,15 mol. Vì Glyxin và Alanin đều chứa 1 nhóm –COOH trong phân tử nên ta có:

Ala-Gly-Ala + 3NaOH → muối + H2O

0,15 mol 0,15.3 mol 0,15 mol

BTKL: 32,55 + 0,45.40 = mmuối + 0,15.18 → mmuối = 47,85 gam.

→ Đáp án A

Câu 6: Cho X là pentapeptit Ala–Gly–Ala–Val–Gly và Y là tripeptit Gly–Ala–Gly. Thủy phân hoàn toàn m gam hỗn hợp gồm X và Y thu được 3 loại amino axit, trong đó có 30 gam glyxin và 26,7 gam alanin. Giá trị của m là

A. 56,7.

B. 54,0.

C. 55,8.

D. 57,2

Đặt nAla–Gly–Ala–Val–Gly = a mol và nGly–Ala–Gly = b mol

→ Bảo toàn Gly ta có: nGlyxin: 2a + 2b = 0,4

→ Bảo toàn Ala ta có: nAlanin = 2a + b = 0,3

→ a = b = 0,1 mol

→ m = 0,1 . (445 – 18.4 + 239 – 18.2) = 57,6 gam

→ Đáp án A

Câu 7: Đun nóng 32,9 gam một peptit mạch hở X với 200 gam dung dịch NaOH 10% (vừa đủ). Sau phản ứng thu được dung dịch Y. Cô cạn dung dịch Y thu được 52 gam muối khan. Biết răng X tạo thành từ các α-amino axit mà phân tử chứa 1 nhóm NH2 và 1 nhóm COOH. Số liên kết peptit trong X là:

A. 10

B. 9

C. 5

D. 4

mNaOH = 20 gam; Gọi số gốc amino axit trong X là n

Do X tạo thành từ các amino axit có 1 nhóm -COOH và 1 nhóm -NH2, nên:

X + n NaOH → muối + H2O

0,5 0,05

BTKL: mX + mNaOH = mmuối + mnước

m_{H_2O} = 32,9 + 20 – 52 = 0,9 gam → n_{H_2O} = 0,05 mol

Ta có: 0,05.n = 0,5 → n = 10.

X là peptit mạch hở tạo thành từ n gốc amino axit thì số liên kết peptit là n – 1

Vậy trong trường hợp này số liên kết peptit trong X là 9 liên kết.

→ Đáp án B

Câu 8: X là đipeptit Ala-Glu, Y là tripeptit Ala-Ala-Gly. Đun nóng m (gam) hỗn hợp chứa X và Y có tỉ lệ số mol của X và Y tương ứng là 1:2 với dung dịch NaOH vừa đủ. Phản ứng hoàn toàn thu được dung dịch T. Cô cạn cẩn thận dung dịch T thu được 56,4 gam chất rắn khan. Giá trị của m là:

A. 45,6

B. 40,27.

C. 39,12.

D. 38,68.

Gọi nAla-Glu = x mol và nAla-Ala-Gly = 2x mol

→ T chứa AlaNa (5x), GlyNa (2x) và GluNa2 (x)

m rắn = 111.5x + 97.2x + 191x = 56,4 gam

→ x = 0,06 mol

→ m = 0,06.(89 + 147 - 18) + 0,12.(89.2 + 75 - 2.18) = 39,12 gam

→ Đáp án C

Câu 9: Cho X là hexapeptit, Ala-Gly-Ala-Val-Gly-Val và Y là tetrapeptit Gly-Ala-Gly-Glu. Thủy phân hoàn toàn m gam hỗn hợp gồm X và Y thu được 4 amino axit, trong đó có 30 gam glyxin và 28,48 gam alanin. Giá trị của m là

A. 77,6

B. 83,2

C. 87,4

D. 73,4

Đặt x, y là số mol X, Y

Bảo toàn Gly → nGly = 2x + 2y = 0,4 mol

Bảo toàn Ala → nAla = 2x + y = 0,32 mol

→ x = 0,12 và y = 0,08

→ m = 472x + 332y = 83,2g

→ Đáp án B

Câu 10: Đun nóng m gam hỗn hợp gồm a mol tetrapeptit mạch hở X và 2a mol tripeptit mạch hở Y với 600 ml dung dich NaOH 1M vừa đủ. Sau khi các phản ứng kết thúc, cô cạn dung dịch thu được 72,48 gam muối khan của các amino axit đều có một nhóm -COOH và một nhóm -NH2 trong phân tử. Giá trị của m là:

A. 51,72.

B. 54,30.

C. 66,00.

D. 44,48.

X + 4NaOH → 4Muối + H2O

a     4a       a

Y + 3NaOH → 3Muối + H2O

2a  6a        2a

Ta có: nNaOH= 10a = 0,6 → a = 0,06 mol

BTKL: m + 0,6.40 = 72,48 + 0,18.18 ⇒ m= 51,72 gam

→ Đáp án A

Mời các bạn tham khảo thêm các bài viết dưới đây của chúng tôi:

Trên đây VnDoc đã giới thiệu tới các bạn Bài tập thủy phân Peptit và Protein. Để có kết quả cao hơn trong học tập, VnDoc xin giới thiệu tới các bạn học sinh tài liệu Giải bài tập Toán lớp 12, Giải bài tập Hóa học lớp 12, Giải bài tập Vật Lí 12, Tài liệu học tập lớp 12VnDoc tổng hợp và đăng tải.

Đánh giá bài viết
1 132
Chuyên đề Hóa học lớp 12 Xem thêm