Cách làm bài tập về chất béo

Chuyên đề Hóa học 12 Cách làm bài tập về chất béo được VnDoc biên soạn bạn học giải các dạng bài tập liên quan đến làm bài tập về chất. Nội dung tài liệu sẽ giúp các bạn giải bài tập Hóa học lớp 12 hiệu quả hơn. Mời các bạn tham khảo.

A. Tóm tắt lí thuyết

I. Khái niệm chất béo

Chất béo là trieste của glixerol với axit béo, gọi chung là triglixerit hay là triaxylglixerol.

* CTCT chung của chất béo:

{R^1}COO - \mathop C\limits_{\left. {} \right|} {H_2}\\
{R^2}COO - \mathop C\limits_{\left. {} \right|} H\\
\underbrace {{R^3}CO}_{g\mathop {\widehat o}\limits^/ caxitb\mathop e\limits^/ o}\underbrace {O - C{H_2}}_{g\mathop {\widehat o}\limits^/ cglyxerol}

R1, R2, R3 là gốc hiđrocacbon của axit béo, có thể giống hoặc khác nhau.

* Axit béo là axit đơn chức có số cacbon chẵn (thường từ 12C đến 24C), mạch C dài, không phân nhánh, có thể no hoặc không no.

+ Các axit béo thường gặp:

Loại no:

C17H35COOH: axit stearic C15H31COOH: axit panmitic.

Loại không no:

C17H33COOH: axit oleic C17H31COOH: axit linoleic

II. Tính chất vật lí và phân loại chất béo.

Tính chất vật lí:

Ở điều kiện thường, chất béo ở trạng thái lỏng hoặc rắn.

Chất béo không tan trong nước. Tan tốt trong dung môi hữu cơ như: nước xà phòng, benzen,... Chất béo nhẹ hơn nước.

Phân loại:

Chất béo gồm có 2 loại:

+ Các triglixerit chứa gốc axit béo đều no thường là chất rắn ở điều kiện thường. Còn gọi là chất béo rắn (mỡ, bơ nhân tạo,...).

Nghĩa là: Các gốc đều no thì chất béo đó thuộc chất béo rắn.

+ Các triglixerit chứa gốc axit béo không no thường là chất lỏng ở điều kiện thường. Còn gọi là chất béo lỏng (dầu ăn,...).

- Nghĩa là: Một trong các gốc không no thì chất béo thuộc chất béo lỏng.

Ví dụ:

{C_{17}}{H_{35}}COO - C{H_2}\\
{C_{15}}{H_{31}}COO - \mathop C\limits_{\left. {} \right|}^{\left. {} \right|} H\\
\underbrace {{C_{17}}{H_{33}}COO - C{H_2};{{({C_{17}}{H_{31}}COO)}_3}{C_3}{H_5}}_{};\underbrace {{{({C_{15}}{H_{31}}COO)}_3}{C_3}{H_5}}_{}

Chất béo lỏng                                    Chất béo rắn

III. Tính chất hóa học.

Chất béo là trieste nên chúng có tính chất của este như: phản ứng thủy phân, phản ứng ở gốc, ...

Phản ứng thủy phân:

a. Thủy phân trong môi trường axit:

Đặc điểm của phản ứng: phản ứng thuận nghịch.

{R^1}COO - \mathop C\limits_{\left. {} \right|} {H_2}\\
{R^2}COO - \mathop C\limits_{\left. {} \right|} H + 3{H_2}O\overset{H_{2}SO_{4}  }{\rightarrow} {R^1}COOH + {R^2}COOH + {R^3}COOH + \underbrace {{C_3}{H_5}{{(OH)}_3}}_{Gli{\rm{x}}erol}\\
{R^3}COO - C{H_2}

b. Thủy phân trong môi trường kiềm (Xà phòng hóa):

Đặc điểm của phản ứng: phản ứng một chiều.

{R^1}COO - \mathop C\limits_{\left. {} \right|} {H_2}\\
{R^2}COO - \mathop C\limits_{\left. {} \right|} H + 3NaOH\overset{^{\circ } }{\rightarrow} {R^1}COONa + {R^2}COONa + {R^3}COONa + \underbrace {{C_3}{H_5}{{(OH)}_3}}_{Gli{\rm{x}}erol}\\
{R^3}COO - C{H_2}

* Muối thu được sau phản ứng là thành phần chính của xà phòng.

* Chú ý: (1) Khi thủy phân chất béo luôn thu được glixerol.

(2) Sơ đồ thủy phân chất béo trong dung dịch kiềm:

Triglixerit + 3OH Muối + Glixerol.

Phản ứng cộng(Đối với chất béo lỏng):

a. Cộng H2: Biến chất béo lỏng thành chất béo rắn.

VD: Cách làm bài tập chất béo

b. Cộng Br2 dung dịch, I2,…

VD: Cách làm bài tập chất béo

Phản ứng oxi hóa: 

- Oxi hóa hoàn toàn tạo CO2 và H2O:

VD: Cách làm bài tập chất béo

- Oxi hóa không hoàn toàn, các liên kết C=C trong chất béo lỏng bị oxi hóa chậm bởi oxi không khí tạo peoxit, chất này phân hủy tạo andehit có mùi khó chịu (hôi, khét,..) làm cho dầu mỡ bị ôi.

B. Các dạng bài tập chất béo

Dạng 1. Lý thuyết

Câu 1. Cho glixerin trioleat (hay triolein) lần lượt vào mỗi ống nghiệm chứa riêng biệt: Na, Cu(OH)2, CH3OH, dung dịch Br2, dung dịch NaOH. Trong diều kiện thích hợp, số phản ứng xảy ra là:

A. 2

B. 3

C. 5

D. 4

Xem đáp án
Đáp án A

(C17H33COO)3C3H5 + Br2 → (C17H33Br2COO)3C3H5

(C17H33COO)3C3H5 + 3NaOH → 3C17H33COONa + C3H5(OH)3

Câu 2. Để biến một số dầu thành mỡ rắn hoặc bơ nhân tạo người ta thực hiện quá trình

A. Hidro hóa (có Ni xúc tác)

B. Cô cạn ở nhiệt độ cao.

C. Làm lạnh

D. Xà phòng hóa

Xem đáp án
Đáp án A

Các gốc đều no thì chất béo đó thuộc chất béo rắn.

Một trong các gốc không no thì chất béo thuộc chất béo lỏng.

Vậy để các gốc không no chuyển thành các gốc no ta thực hiện quá trình hidro hóa (có Ni xúc tác, to)

Câu 3. Chất béo là trieste của axit béo với

A. ancol etylic.

B. ancol metylic.

C. etylen glicol.

D. glixerol.

Câu 4. Triolein không tác dụng với chất (hoặc dung dịch) nào sau đây?

A. Khí H2 (xúc tác Ni nung nóng).

B. Kim loại Na.

C. Dung dịch KOH (đun nóng).

D. Dung dịch Brom

Xem đáp án
Đáp án D

Triolein có công thức cấu tạo: (C17H33COO)3C3H5. Vậy:

+ Gốc C17H33- là gốc không no(tức là có liên kết ) nên có phản ứng cộng H2, Br2 dung dịch (Brom mất màu).

+ Triolein loại este nên có phản ứng thủy phân trong môi trường axit và kiềm.

Nên triolein tác dụng với dung dịch KOH.

Câu 5. Phát biểu nào sau đây không đúng?

A. Chất béo là trieste của etylen glicol với các axit béo.

B. Các chất béo thường không tan trong nước và nhẹ hơn nước.

C. Triolein có khả năng tham gia phản ứng cộng hiđro (to, xúc tác Ni).

D. Chất béo bị thủy phân khi đun nóng trong dung dịch kiềm.

Hướng dẫn giải

Xem đáp án
Đáp án A loại vì Chất béo là trieste của glixerol với các axit béo.

Câu 6. Số trieste khi thủy phân đều thu được sản phẩm gồm glixerol, axit CH3COOH và axit C2H5COOH

A. 9.

B. 4.

C. 6.

D. 2.

Xem đáp án
Đáp án B

Có 4 trieste thỏa mãn là





Câu 7. Cho glixerol phản ứng với hỗn hợp axit béo gồm C17H35COOH và C15H31COOH. Số loại trieste được tạo ra là

A. 6.

B. 4.

C. 5.

D. 3.

Xem đáp án
Đáp án A

Câu 8. Cho các phát biểu sau:

(a) Chất béo được gọi chung là triglixerit hay triaxylglixerol.

(b) Chất béo nhẹ hơn nước, không tan trong nước nhưng tan nhiều trong dung môi hữu cơ.

(c) Phản ứng thủy phân chất béo trong môi trường axit là phản ứng thuận nghịch.

(d) Tristearin, triolein có công thức lần lượt là: (C17H35COO)3C3H5, (C17H33COO)3C3H5.

(e) Muối phenylamoni clorua không tan trong nước.

(f) Ở điều kiện thường, etylamin và propylamin là những chất khí có mùi khai.

Số phát biểu đúng là

A. 2.

B. 4.

C. 1.

D. 3.

Xem đáp án
Đáp án D

Tristearin, triolein có công thức lần lượt là: (C17H35COO)3C3H5, (C17H33COO)3C3H5 → d sai

Muối phenylamoni clorua chứa liên kết ion nên tan trong nước → e sai

propylamin là chất lỏng ở điều kiện thường → f sai

Câu 9. Cho các phát biểu sau:

1. Trong một phân tử triolein có 3 liên kết π.

2. Muối natri hoặc kali của axit hữu cơ là xà phòng.

3. Khi đun chất béo lỏng với hiđro có xúc tác niken trong nồi hấp thì chúng chuyển thành chất béo rắn.

4. Chất béo lỏng là các triglixerit chứa gốc axit béo không no trong phân tử.

5. Lipit là chất béo.

Số phát biểu đúng là:

A. 3.

B. 1.

C. 4.

D. 2.

Xem đáp án
Đáp án D

Câu 10. Đốt cháy hoàn toàn chất hữu cơ nào sau đây thu được sản phẩm có chứa N2?

A. Chất béo.

B. Tinh bột.

C. Xenlulozơ.

D. Protein.

Xem đáp án
Đáp án D

Thành phần nguyên tố tạo nên: Chất béo, tinh bột, xenlulozo là C, H, O. Nên khi cháy thu được CO2, H2O.

Thành phần nguyên tố tạo Protein là C, H, O, N. Nên khi cháy thu được CO2, H2O, N2.

Dạng 2. Bài tập xà phòng phòng hóa chất béo

Để làm tốt loại bài tập này cần nắm vững nội dung sau

(1) Este của chất béo là triglixerit thuộc trieste (este ba chức).

(2) Axit béo thuộc loại axit đơn chức.

(3) Công thức chất béo rắn: (CnH2n+1COO)3C3H5 = C3n+6H6n+8O6

Hay: CxH2x-4O6 Với x = 3n + 8.

=> CTPT tổng quát của chất béo: CxH2x-4-2kO6

Với n: Chỉ số C; k là số liên kết .

(4) Với chất béo trung tính(chất béo không có chỉ số axit) khi xà phòng hóa:

Ta có:

ĐLBTKL: mchất béo + mMOH = mmuối + mglixerol

+ ntriglixerit = nglixerol; nKOH =3 ntriglixerit = 3nglixerol

(5) Với chất béo có chỉ số axit khi xà phòng hóa:

- Coi chất béo là hỗn hợp gồm axit đơn chức và trieste:

Ta có: RCOOH + MOH → RCOOM + H2O.

x            x                                x mol.

{(RCOO)_{^3}}{C_3}{H_5} + 3MOH \to 3RCOOM + {C_3}{H_5}{(OH)_3}

y                       3 y                                               y mol

ĐLBTKL: mchất béo + mMOH = mmuối + mglixerol + m H2O

Muối thu được là thành phần chính của xà phòng.

Bài tập  vận dụng củng cố

Câu 1. Xà phòng hóa hoàn toàn 17,24 gam chất béo cần dùng vừa đủ 0,06 mol NaOH, cô cạn dung dịch sau phản ứng thu được khối lượng xà phòng là

A. 18,24 gam.

B. 17,8 gam.

C. 16,68 gam.

D.18,38 gam.

Đáp án hướng dẫn giải bài tập

Chất béo này thuộc loại trung tính. Vì không có chỉ số axit

nNaOH = 0,06 mol =>nglixerol = 0,06/3 = 0,02 mol

ĐLBTKL: mchất béo + mNaOH = mmuối + mglixerol

17,24 + 0,06.40 =mmuối + 0,02.92=> mmuối = 17,8g

Câu 2. Cho 200 gam một loại chất béo có chỉ số axit bằng 7 tác dụng vừa đủ với một lượng NaOH, thu được 207,55 gam hỗn hợp muối khan. Khối lượng NaOH đã tham gia phản ứng là

A. 31,45 gam.

B. 31 gam.

C. 32,36 gam.

D.30 gam.

Đáp án hướng dẫn giải bài tập

Chất béo có chỉ số axit => Coi chất béo là hỗn hợp gồm axit đơn chức và trieste:

Ta có: RCOOH + NaOH → RCOONa + H2O.(1)

x            x                         x mol.

{(RCOO)_{^3}}{C_3}{H_5} + 3NaOH \to 3RCOONa + {C_3}{H_5}{(OH)_3}             (2)

y                               3y                                               y mol

Với chỉ số axit bằng 7, từ công thức [1.1 ]=> nKOH= (200.7)/56 = 0,025 mol

x = nNaOH = nKOH= 0,025mol.

ĐLBTKL: mchất béo + mNaOH = mmuối + mglixerol + m

200 + 40.(0,025 + 3y) = 207,55 + 92.y + 18.0,025

=> y= 0,25

Vậy nNaOH= 0,025+3y = 0,025 + 3. 0,25 = 0,775 mol.

mNaOH= 0,775.40 = 31g

Câu 3. Xà phòng hóa hoàn toàn trieste X bằng dd NaOH thu được 9,2g glixerol và 83,4g muối của một axit no. Axit đó là:

A. Stearic

B. Oleic

C. Panmitic

D. Linoleic

Đáp án hướng dẫn giải bài tập

nglixerol = 0,1mol

(RCOO)3C3H5 + 3NaOH → 3RCOONa + C3H5(OH)3

0,3 mol       0,1 mol

mmuối = 83,4/3 = 27,8 gam

⇒ Mmuối = 27,8: 0,1 = 278 ⇒ Maxit = 278 -22 = 256 (panmitic)

Câu 4. Xà phòng hóa 100g chất béo có chỉ số a xit bằng 7 cần ag dd NaOH 25% thu được 9,43g glixerol và bg muối natri, giá trị của a,b là:

A. 15,2 và 103,145

B. 5,12 và 10,3145

C. 51,2 và 103,145

D. 51,2 và 10,3145

Đáp án hướng dẫn giải bài tập

Vì chỉ số a xit bằng 7 ⇒ nNaOH = nKOH = 0,7/56 = 0,0125 mol

nGlixerol = 9,43/92 = 0,1025 mol

(RCOO)3C3H5 + 3NaOH → 3RCOONa + C3H5(OH)3

0,3075 mol     0,1025 mol


Tổng nNaOH = 0,1025.3 + 0,0125 = 0,32 mol

a = mdd NaOH = (0,32.40)/25% = 51,2g

Theo định luật bảo toàn khối lượng cả 2 phương trình :

b = mmuối = mchất béo + mNaOH - mglixerol - mnước = 100 +0,32.40 – 9,43 – 0,0125.18 = 103,145g

Dạng 3. Phản ứng đốt cháy

Câu 1: Đốt cháy hoàn toàn 1 mol chất béo thu được số mol CO2 nhiều hơn số mol nước là 6 mol. Mặt khác a mol chất béo trên tác dụng với 600 ml dung dịch brom 1M. Giá trị của a là

A. 0,15

B. 0,015

C. 0,12

D. 0,20

Đáp án hướng dẫn giải bài tập

nCO2 - nH2O = 6.n chất béo

→ số liên kết π trong chất béo = 6 + 1 = 7

Số liên kết π trong mạch cacbon (trừ đi liên kết π trong 3 nhóm R-COO): 7 - 3 = 4

→ a = 0,6 : 4 = 0,15 mol

Câu 2: Đốt cháy hoàn toàn m gam một chất béo (triglixerit) cần 3,22 mol O2, sinh ra 2,28 mol CO2 và 2,12 mol H2O. Cũng m gam chất béo này tác dụng vừa đủ với dung dịch NaOH thì khối lượng muối tạo thành là

A. 18,28 gam. B. 33,36 gam. C. 46,00 gam. D. 36,56 gam.

Đáp án hướng dẫn giải chi tiết

Chất béo có dạng: (RCOO)3C3H5

Gọi số mol chất béo là a mol.

Chất béo + O2 → CO2 + H2O

BTKL: mtriglixerit + mO2 = mCO2 + mH2O => m + 3,22.32 = 2,28.44 + 2,12.18

=> m = 35,44 gam

Áp dụng ĐLBT cho oxi: nO (chất béo) + nO(O2) = nO (CO2) + nO (H2O)

=> 6nchất béo + 2nO2 = 2nCO2 + nH2O

=> 6a + 2.3,22 = 2.2,28 + 2,12 => a = 0,04 mol

(RCOO)3C3H5 + 3NaOH → 3RCOONa + C3H5(OH)3

0,04 → 0,12 → 0,04

BTKL: mchất béo + mNaOH = mmuối + mglixerol

=> 35,44 + 0,12.40 = mmuối + 0,04.92 => mmuối = 36,56 gam

Dạng 4. Bài tập tổng hợp

Câu 1. Đốt cháy hoàn toàn 1 mol chất béo, thu được lượng CO2 và H2O hơn kém nhau 6 mol. Mặt khác a mol chất béo trên tác dụng tối đa với 600 ml dung dịch Br2 1M. Giá trị của a là

A. 0,20.B. 0,30.C. 0,18.D. 0,15.

Đáp án hướng dẫn giải bài tập

CTTQ chung chất béo: CxH2x-4-2kO6

CxH2x – 4 - 2kO6 + \frac{{3x - k - 8}}{2}O2 \overset{t^{\circ } }{\rightarrow} x CO2 + (x – 2 – k)H2O

1 mol                                                       x          x – 2 – k (mol)

Theo bài ra: Lượng CO2 và H2O hơn kém nhau 6 mol

Từ pứ ta có:  {n_{C{O_2}}} - {n_{{H_2}O}} = 6x – (x – 2 – k) =6 => k = 4.

Vậy, nchất béo= a mol =>  n lkπ  (trong chất béo) = 4a =nH2 (pứ)

4a = 0,6 => a = 0,15

Câu 2. E là một chất béo được tạo bởi hai axit béo X, Y(có cùng số C, trong phân tử chứa không quá ba liên kết , MX<MY, số mol Y< số mol của X) và glixerol. Xà phòng hóa hoàn toàn 7,98 gam E bằng KOH vừa đủ thu được 8,74 gam hỗn hợp hai muối. Mặt khác, nếu đem đốt cháy hoàn toàn 7,98 gam E thu được 0,51 mol CO2 và 0,45 mol H2O. Khối lượng mol phân tử của X gần nhất:

A. 281

B. 253

C. 282

D. 250.

Đáp án hướng dẫn giải bài tập

Vì E là một chất béo được tạo bởi hai axit béo X, Y (có cùng số C ):

=> CT PT của E có dạng: {({C_n}{H_{\bar m}}COO)_3}{C_3}{H_5}: a mol => nO(E) = 6a mol.

Ta có: E + O2 → CO2 + H2O.

ĐLBTKL: {m_E} + {m_{{O_2}}} = {m_{C{O_2}}} + {m_{{H_2}O}}{m_{{O_2}}} = 0,51*44 + 0,45.18 – 7,98 = 22,56 gam.

ĐLBTNT Oxi: nO(E) + 2n_{{O_2}} = 2{n_{C{O_2}}} + {n_{{H_2}O}}

6a + 2x \frac{{22,56}}{{32}} = 2x 0,51 + 0,45 =>  a = 0,01

Ta có : Số C(E) = 3n + 6 = \frac{{{n_{C{O_2}}}}}{{{n_E}}} = 51 => n = 15

Số (E) = 3 +5 = \frac{{2{n_{{H_2}O}}}}{{{n_E}}}= 90 =>= 28,333

Vì X, Y có cùng số C, trong phân tử chứa không quá ba liên kết , MX < MY

X: CnH2n + 1– 2kCOOH với n = 15; k = 1; 2; 2n + 1 – 2k < 28,33

Vậy n = 15; k = 2 => X: C15H27COOH (MX= 252)

Câu 3. Giả sử một chất béo có công thức: (RCOO)3C3H5. Muốn điều chế 30 kg xà phòng từ chất béo này thì cần dùng bao nhiêu kg chất béo này đề tác dụng với dung dịch xút? Coi phản ứng xảy ra hoàn toàn. Tính số kg chất béo đó

Đáp án hướng dẫn giải bài tập

Gọi số mol của chất béo đó là x ta có:

(RCOO)3C3H5 + 3NaOH → 3RCOONa + C3H5(OH)3

x                          3x                                     x

Bảo toàn khối lượng => 860x +3x.40 = m xà phòng + 92.x

Theo đề bài: m xà phòng = 30000 gam => 888x = 30000 => x = 33,78

Khối lượng chất béo = 33,78.860 = 29050,8 gam = 29,0508 kg

Câu 4. Đun sôi m gam một triglirit X với dung dịch KOH đến phản ứng hoàn toàn thu được 0,92 gam glixerol và a gam hỗn hợp Y gồm muối của axit oleic với 3,18 gam muối của axit linoleic. Công thức của X và m là:

Đáp án hướng dẫn giải bài tập

Phản ứng của X với KOH:

(C17H31COO)xC3H5(OOCC17H33)y + 3KOH → xC17H31COOK + yC17H33COOK + C3H5(OH)3

Từ pt: nC17H31COOK = x.nC3H5(OH)3 = 0,01x mol = 3,18/318= 0,01 mol

→ x = 1 →y = 2

X có công thức cấu tạo: C17H31COOC3H5(OOCC17H33)2.

b) Ta có : nC17H33COOK = 0,02 mol ⟹ m=  mC17H33COOK = 0,02.320 = 6,4 (g)


Để tải chi tiết nội dụng tài liệu xin vui lòng kéo xuống phía dưới ấn link tải về.

Mời các bạn tham khảo thêm các bài viết dưới đây của chúng tôi:

Trên đây VnDoc đã giới thiệu tới các bạn Cách làm bài tập về chất béo. Để có kết quả cao hơn trong học tập, VnDoc xin giới thiệu tới các bạn học sinh tài liệu Giải bài tập Toán lớp 12, Giải bài tập Hóa học lớp 12, Giải bài tập Vật Lí 12, Tài liệu học tập lớp 12VnDoc tổng hợp và đăng tải.

Ngoài ra, VnDoc.com đã thành lập group chia sẻ tài liệu ôn tập THPT Quốc gia miễn phí trên Facebook: Tài liệu học tập lớp 12 Mời các bạn học sinh tham gia nhóm, để có thể nhận được những tài liệu, đề thi mới nhất.

Đánh giá bài viết
2 29.326
Sắp xếp theo
    Chuyên đề Hóa học lớp 12 Xem thêm