Cách làm bài tập về chất béo

Chuyên đề Hóa học 12 Cách làm bài tập về chất béo. Nội dung tài liệu sẽ giúp các bạn giải bài tập Hóa học lớp 12 hiệu quả hơn. Mời các bạn tham khảo.

I. Tóm tắt lí thuyết

1. Khái niệm chất béo:

Chất béo là trieste của glixerol với axit béo, gọi chung là triglixerit hay là triaxylglixerol.

* CTCT chung của chất béo:

\begin{array}{l} {R^1}COO - \mathop C\limits_{\left. {} \right|} {H_2}\\ {R^2}COO - \mathop C\limits_{\left. {} \right|} H\\ \underbrace {{R^3}CO}_{g\mathop {\widehat o}\limits^/ caxitb\mathop e\limits^/ o}\underbrace {O - C{H_2}}_{g\mathop {\widehat o}\limits^/ cglyxerol} \end{array}

R1, R2, R3 là gốc hiđrocacbon của axit béo, có thể giống hoặc khác nhau.

* Axit béo là axit đơn chức có số cacbon chẵn (thường từ 12C đến 24C), mạch C dài, không phân nhánh, có thể no hoặc không no.

+ Các axit béo thường gặp:

Loại no:

C17H35COOH: axit stearic C15H31COOH: axit panmitic.

Loại không no:

C17H33COOH: axit oleic C17H31COOH: axit linoleic

2. Tính chất vật lí và phân loại chất béo.

Tính chất vật lí:

Ở điều kiện thường, chất béo ở trạng thái lỏng hoặc rắn.

Chất béo không tan trong nước. Tan tốt trong dung môi hữu cơ như: nước xà phòng, benzen,... Chất béo nhẹ hơn nước.

Phân loại:

Chất béo gồm có 2 loại:

+ Các triglixerit chứa gốc axit béo đều no thường là chất rắn ở điều kiện thường. Còn gọi là chất béo rắn (mỡ, bơ nhân tạo,...).

Nghĩa là: Các gốc đều no thì chất béo đó thuộc chất béo rắn.

+ Các triglixerit chứa gốc axit béo không no thường là chất lỏng ở điều kiện thường. Còn gọi là chất béo lỏng (dầu ăn,...).

- Nghĩa là: Một trong các gốc không no thì chất béo thuộc chất béo lỏng.

Ví dụ:

\begin{array}{l} {C_{17}}{H_{35}}COO - C{H_2}\\ {C_{15}}{H_{31}}COO - \mathop C\limits_{\left. {} \right|}^{\left. {} \right|} H\\ \underbrace {{C_{17}}{H_{33}}COO - C{H_2};{{({C_{17}}{H_{31}}COO)}_3}{C_3}{H_5}}_{};\underbrace {{{({C_{15}}{H_{31}}COO)}_3}{C_3}{H_5}}_{} \end{array}

            Chất béo lỏng                  Chất béo rắn

3. Tính chất hóa học.

 Chất béo là trieste nên chúng có tính chất của este như: phản ứng thủy phân, phản ứng ở gốc, ...

Phản ứng thủy phân:

a. Thủy phân trong môi trường axit:

Đặc điểm của phản ứng: phản ứng thuận nghịch.

\begin{array}{l} {R^1}COO - \mathop C\limits_{\left. {} \right|} {H_2}\\ {R^2}COO - \mathop C\limits_{\left. {} \right|} H + 3{H_2}O\overset{H_{2}SO_{4} }{\rightarrow} {R^1}COOH + {R^2}COOH + {R^3}COOH + \underbrace {{C_3}{H_5}{{(OH)}_3}}_{Gli{\rm{x}}erol}\\ {R^3}COO - C{H_2} \end{array}

b. Thủy phân trong môi trường kiềm (Xà phòng hóa):

Đặc điểm của phản ứng: phản ứng một chiều.

\begin{array}{l} {R^1}COO - \mathop C\limits_{\left. {} \right|} {H_2}\\ {R^2}COO - \mathop C\limits_{\left. {} \right|} H + 3NaOH\overset{^{\circ } }{\rightarrow} {R^1}COONa + {R^2}COONa + {R^3}COONa + \underbrace {{C_3}{H_5}{{(OH)}_3}}_{Gli{\rm{x}}erol}\\ {R^3}COO - C{H_2} \end{array}

* Muối thu được sau phản ứng là thành phần chính của xà phòng.

* Chú ý: (1) Khi thủy phân chất béo luôn thu được glixerol.

(2) Sơ đồ thủy phân chất béo trong dung dịch kiềm:

Triglixerit + 3OH Muối + Glixerol.

Phản ứng cộng(Đối với chất béo lỏng):

a. Cộng H2: Biến chất béo lỏng thành chất béo rắn.

VD: Cách làm bài tập chất béo

b. Cộng Br2 dung dịch, I2,…

VD: Cách làm bài tập chất béo

Phản ứng oxi hóa: 

- Oxi hóa hoàn toàn tạo CO2 và H2O:

VD: Cách làm bài tập chất béo

- Oxi hóa không hoàn toàn, các liên kết C=C trong chất béo lỏng bị oxi hóa chậm bởi oxi không khí tạo peoxit, chất này phân hủy tạo andehit có mùi khó chịu (hôi, khét,..) làm cho dầu mỡ bị ôi.

II. Các dạng bài tập chất béo

Dạng 1. Lý thuyết

Câu 1. Cho glixerin trioleat (hay triolein) lần lượt vào mỗi ống nghiệm chứa riêng biệt: Na, Cu(OH)2, CH3OH, dung dịch Br2, dung dịch NaOH. Trong diều kiện thích hợp, số phản ứng xảy ra là:

A.2

B. 3

C. 5

D.4

Câu 2. Để biến một số dầu thành mỡ rắn hoặc bơ nhân tạo người ta thực hiện quá trình

A. Hidro hóa (có Ni xúc tác)

B. Cô cạn ở nhiệt độ cao.

C. Làm lạnh

D. Xà phòng hóa

Hướng dẫn giải

Các gốc đều no thì chất béo đó thuộc chất béo rắn.

 Một trong các gốc không no thì chất béo thuộc chất béo lỏng.

Vậy để các gốc không no chuyển thành các gốc no ta thực hiện quá trình hidro hóa (có Ni xúc tác, to)

Câu 3. Chất béo là trieste của axit béo với

A. ancol etylic.

B. ancol metylic.

C. etylen glicol.

D. glixerol.

Câu 4. Triolein không tác dụng với chất (hoặc dung dịch) nào sau đây?

A. Khí H2 (xúc tác Ni nung nóng).

B. Kim loại Na.

C. Dung dịch KOH (đun nóng).

D. Dung dịch Brom

Hướng dẫn giải

Triolein có công thức cấu tạo: (C17H33COO)3C3H5. Vậy:

+ Gốc C17H33- là gốc không no(tức là có liên kết ) nên có phản ứng cộng H2, Br2 dung dịch(Brom mất màu).

+ Triolein loại este nên có phản ứng thủy phân trong môi trường axit và kiềm.

Nên triolein tác dụng với dung dịch KOH.

Câu 5. Phát biểu nào sau đây không đúng?

A. Chất béo là trieste của etylen glicol với các axit béo.

B. Các chất béo thường không tan trong nước và nhẹ hơn nước.

C. Triolein có khả năng tham gia phản ứng cộng hiđro (to, xúc tác Ni).

D. Chất béo bị thủy phân khi đun nóng trong dung dịch kiềm.

Hướng dẫn giải

Đáp án A loại vì Chất béo là trieste của glixerol với các axit béo.

Câu 6. Số trieste khi thủy phân đều thu được sản phẩm gồm glixerol, axit CH3COOH và axit C2H5COOH

A. 9.

B. 4.

C. 6.

D. 2.

Hướng dẫn giải

Có 4 trieste thỏa mãn là

1, CH2(OCOCH3)-CH(OCOCH3)-CH2(OCOC2H5)

2, CH2(OCOCH3)-CH(OCOC2H5)-CH2(OCOCH3)

3, CH2(OCOC2H5)-CH(OCOC2H5)-CH2(OCOCH3)

4, CH2(OCOC2H5)-CH(OCOCH3)-CH2(OCOC2H5)

Câu 7. Cho glixerol phản ứng với hỗn hợp axit béo gồm C17H35COOH và C15H31COOH. Số loại trieste được tạo ra là

A. 6.

B. 4.

C. 5.

D. 3.

Câu 8. Cho các phát biểu sau:

(a) Chất béo được gọi chung là triglixerit hay triaxylglixerol.

(b) Chất béo nhẹ hơn nước, không tan trong nước nhưng tan nhiều trong dung môi hữu cơ.

(c) Phản ứng thủy phân chất béo trong môi trường axit là phản ứng thuận nghịch.

(d) Tristearin, triolein có công thức lần lượt là: (C17H35COO)3C3H5, (C17H33COO)3C3H5.

(e) Muối phenylamoni clorua không tan trong nước.

(f) Ở điều kiện thường, etylamin và propylamin là những chất khí có mùi khai.

Số phát biểu đúng là

A. 2.

B. 4.

C. 1.

D. 3.

Hướng dẫn giải

Tristearin, triolein có công thức lần lượt là: (C17H35COO)3C3H5, (C17H33COO)3C3H5 → d sai

Muối phenylamoni clorua chứa liên kết ion nên tan trong nước → e sai

propylamin là chất lỏng ở điều kiện thường → f sai

Câu 9. Cho các phát biểu sau:

1. Trong một phân tử triolein có 3 liên kết π.

2. Muối natri hoặc kali của axit hữu cơ là xà phòng.

3. Khi đun chất béo lỏng với hiđro có xúc tác niken trong nồi hấp thì chúng chuyển thành chất béo rắn.

4. Chất béo lỏng là các triglixerit chứa gốc axit béo không no trong phân tử.

5. Lipit là chất béo.

Số phát biểu đúng là:

A. 3.

B. 1.

C. 4.

D. 2.

Câu 10. Đốt cháy hoàn toàn chất hữu cơ nào sau đây thu được sản phẩm có chứa N2?

A. Chất béo.

B. Tinh bột.

C. Xenlulozơ.

D. Protein.

Hướng dẫn giải

Thành phần nguyên tố tạo nên: Chất béo, tinh bột, xenlulozo là C, H, O. Nên khi cháy thu được CO2, H2O.

Thành phần nguyên tố tạo Protein là C, H, O, N. Nên khi cháy thu được CO2, H2O, N2.

Dạng 2. Bài tập xà phòng phòng hóa chất béo

Để làm tốt loại bài tập này cần nắm vững nội dung sau:

(1) Este của chất béo là triglixerit thuộc trieste (este ba chức).

(2) Axit béo thuộc loại axit đơn chức.

(3) Công thức chất béo rắn: (CnH2n+1COO)3C3H5 = C3n+6H6n+8O6

Hay: CxH2x-4O6 Với x = 3n + 8.

=> CTPT tổng quát của chất béo: CxH2x-4-2kO6

Với n: Chỉ số C; k là số liên kết .

(4) Với chất béo trung tính(chất béo không có chỉ số axit) khi xà phòng hóa:

Ta có:

ĐLBTKL: mchất béo + mMOH = mmuối + mglixerol

+ ntriglixerit = nglixerol; nKOH =3 ntriglixerit = 3nglixerol

(5) Với chất béo có chỉ số axit khi xà phòng hóa:

- Coi chất béo là hỗn hợp gồm axit đơn chức và trieste:

Ta có: RCOOH + MOH → RCOOM + H2O.

        x      x                x mol.

{(RCOO)_{^3}}{C_3}{H_5} + 3MOH \to 3RCOOM + {C_3}{H_5}{(OH)_3}

   y            3 y                        y mol

ĐLBTKL: mchất béo + mMOH = mmuối + mglixerol + m H2O

 Muối thu được là thành phần chính của xà phòng.

Bài tập củng cố

Câu 1. Xà phòng hóa hoàn toàn 17,24 gam chất béo cần dùng vừa đủ 0,06 mol NaOH, cô cạn dung dịch sau phản ứng thu được khối lượng xà phòng là

A. 18,24 gam.

B. 17,8 gam.

C. 16,68 gam.

D.18,38 gam.

Hướng dẫn giải

Chất béo này thuộc loại trung tính. Vì không có chỉ số axit

nNaOH = 0,06 mol =>nglixerol = 0,06/3 = 0,02 mol 

ĐLBTKL: mchất béo + mNaOH = mmuối + mglixerol

17,24 + 0,06.40 =mmuối + 0,02.92=> mmuối = 17,8g

Câu 2. Cho 200 gam một loại chất béo có chỉ số axit bằng 7 tác dụng vừa đủ với một lượng NaOH, thu được 207,55 gam hỗn hợp muối khan. Khối lượng NaOH đã tham gia phản ứng là

A. 31,45 gam.

B. 31 gam.

C. 32,36 gam.

D.30 gam.

Hướng dẫn giải

Chất béo có chỉ số axit => Coi chất béo là hỗn hợp gồm axit đơn chức và trieste:

Ta có: RCOOH + NaOH → RCOONa + H2O.(1)

          x      x             x mol.

{(RCOO)_{^3}}{C_3}{H_5} + 3NaOH \to 3RCOONa + {C_3}{H_5}{(OH)_3}       (2)

 y                3y                        y mol

- Với chỉ số axit bằng 7, từ công thức [1.1 ]=> nKOH= (200.7)/56 = 0,025 mol

x = nNaOH = nKOH= 0,025mol. 

- ĐLBTKL: mchất béo + mNaOH = mmuối + mglixerol + m

200 + 40.(0,025 + 3y) = 207,55 + 92.y + 18.0,025

=> y= 0,25

Vậy nNaOH= 0,025+3y = 0,025 + 3. 0,25 = 0,775 mol.

mNaOH= 0,775.40 = 31g

Dạng 3. Phản ứng cháy

Câu 1: Đốt cháy hoàn toàn 1 mol chất béo thu được số mol CO2 nhiều hơn số mol nước là 6 mol. Mặt khác a mol chất béo trên tác dụng với 600 ml dung dịch brom 1M. Giá trị của a là

A. 0,15

B. 0,015

C. 0,12

D. 0,20

Hướng dẫn giải

nCO2 - nH2O = 6.n chất béo

→ số liên kết π trong chất béo = 6 + 1 = 7

Số liên kết π trong mạch cacbon (trừ đi liên kết π trong 3 nhóm R-COO): 7 - 3 = 4

→ a = 0,6 : 4 = 0,15 mol

Dạng 4. Bài tập tổng hợp

Câu 2. E là một chất béo được tạo bởi hai axit béo X, Y(có cùng số C, trong phân tử chứa không quá ba liên kết , MX<MY, số mol Y< số mol của X) và glixerol. Xà phòng hóa hoàn toàn 7,98 gam E bằng KOH vừa đủ thu được 8,74 gam hỗn hợp hai muối. Mặt khác, nếu đem đốt cháy hoàn toàn 7,98 gam E thu được 0,51 mol CO2 và 0,45 mol H2O. Khối lượng mol phân tử của X gần nhất:

A. 281

B. 253

C. 282

D. 250.

Hướng dẫn giải

Vì E là một chất béo được tạo bởi hai axit béo X, Y (có cùng số C ):

=> CT PT của E có dạng: {({C_n}{H_{\bar m}}COO)_3}{C_3}{H_5}: a mol => nO(E) = 6a mol.

Ta có: E + O2 → CO2 + H2O.

ĐLBTKL: {m_E} + {m_{{O_2}}} = {m_{C{O_2}}} + {m_{{H_2}O}}{m_{{O_2}}} = 0,51*44 + 0,45.18 – 7,98 = 22,56 gam.

ĐLBTNT Oxi: nO(E) + 2n_{{O_2}} = 2{n_{C{O_2}}} + {n_{{H_2}O}}

6a + 2x \frac{{22,56}}{{32}} = 2x 0,51 + 0,45 => a = 0,01

Ta có : Số C(E) = 3n + 6 = \frac{{{n_{C{O_2}}}}}{{{n_E}}} = 51 => n = 15

Số (E) = 3 +5 = \frac{{2{n_{{H_2}O}}}}{{{n_E}}}= 90 =>= 28,333

Vì X, Y có cùng số C, trong phân tử chứa không quá ba liên kết , MX < MY

X: CnH2n + 1– 2kCOOH với n = 15; k = 1; 2; 2n + 1 – 2k < 28,33

Vậy n = 15; k = 2 => X: C15H27COOH (MX= 252)

............................

Để tải chi tiết nội dụng tài liệu xin vui lòng kéo xuống phía dưới ấn link tải về.

Mời các bạn tham khảo thêm các bài viết dưới đây của chúng tôi:

Trên đây VnDoc đã giới thiệu tới các bạn Cách làm bài tập về chất béo. Để có kết quả cao hơn trong học tập, VnDoc xin giới thiệu tới các bạn học sinh tài liệu Giải bài tập Toán lớp 12, Giải bài tập Hóa học lớp 12, Giải bài tập Vật Lí 12, Tài liệu học tập lớp 12VnDoc tổng hợp và đăng tải.

Đánh giá bài viết
1 10.831
0 Bình luận
Sắp xếp theo
Chuyên đề Hóa học lớp 12 Xem thêm