Dạng bài tập về điều chế, tổng hợp các Polime quan trọng

Chuyên đề Hóa học 12 Dạng bài tập về điều chế, tổng hợp các Polime quan trọng. Hy vọng qua bộ tài liệu sẽ giúp các bạn học sinh giải bài tập Hóa học lớp 12 hiệu quả hơn. Mời các bạn tham khảo.

Kiến thức cần nhớ về điều chế, tổng hợp các Polime quan trọng

*Tóm tắt lý thuyết


1. Polietilen (PE)

nCH2=CH2 Dạng bài tập về điều chế, tổng hợp các Polime quan trọng (-CH2-CH2-)n

2. Polipropilen (PP)

nCH2=CH-CH3 Dạng bài tập về điều chế, tổng hợp các Polime quan trọng (-CH2-CH(CH3)-)n

3. Polimetylmetacrylat (PMM)

nCH2=C(CH3)-COOCH3 Dạng bài tập về điều chế, tổng hợp các Polime quan trọng (-CH2-C(CH3)(COOCH3)-)n

4. Polivinyl clorua (PVC)

nCH2=CHCl Dạng bài tập về điều chế, tổng hợp các Polime quan trọng (-CH2-CHCl-)n

5. Polistiren (PS)

nC6H5-CH=CH2 Dạng bài tập về điều chế, tổng hợp các Polime quan trọng (-CH2-CH(C6H5)-)n

6. Nhựa phenolfomanđehit (nhựa bakelit) PPF

- Gồm ba loại novolac, rezol và rezit. Chúng ta thường quan tâm đến novolac.

- Nhựa novolac được tạo thành khi đun nóng hỗn hợp gồm andehit fomic và phenol lấy dư có xúc tác axit. Chất này mạch không phân nhánh.

- Nhựa rezol được tạo ra khi đun nóng hỗn hợp gồm phenol và anđehit fomic theo tỉ lệ mol 1 : 1,2 có xúc tác là kiềm. Chất này mạch không phân nhánh.

- Khi đun nóng nhựa rezol ở 150oc thu được nhựa rezit có cấu trúc mạng không gian.


1. Nilon-6,6

Điều chế bằng cách trùng ngưng hexametylenđiamin và axit ađipic.

nH2N-(CH2)6-NH2 + nHOOC-(CH2)4-COOH Dạng bài tập về điều chế, tổng hợp các Polime quan trọng[-HN-(CH2)6-NH-OC-(CH2)4-CO-]n + 2nH2O.

2. Tơ capron

Trùng hợp caprolactam thu được tơ capron

3. Tơ enang

Điều chế bằng cách trùng ngưng axit 7-aminoheptanoic.

nH2N-(CH2)6-COOH Dạng bài tập về điều chế, tổng hợp các Polime quan trọng [-HN-(CH2)6-CO-]n + nH2O.

4. Tơ lapsan

Điều chế bằng cách trùng ngưng etylen glicol và axit terephtalic.

nHOCH2CH2OH+nHOOC-C6H4-COOH Dạng bài tập về điều chế, tổng hợp các Polime quan trọng (-OCH2-CH2OOC-C6H4-CO-)n.

5. Tơ nitron hay tơ olon

nCH2=CH-CN Dạng bài tập về điều chế, tổng hợp các Polime quan trọng (-CH2-CH(CN)-)n


1. Cao su BuNa

nCH2=CH-CH=CH2 Dạng bài tập về điều chế, tổng hợp các Polime quan trọng (-CH2-CH=CH-CH2-)n

2. Cao su isopren

nCH2=C(CH3)-CH=CH2 Dạng bài tập về điều chế, tổng hợp các Polime quan trọng (-CH2-C(CH3)=CH-CH2-)n

3. Cao su BuNa - N

nCH2=CH-CH=CH2 + nCH2=CH-CN Dạng bài tập về điều chế, tổng hợp các Polime quan trọng(-CH2-CH=CH-CH2-CH2-CH(CN)-)n

4. Cao su BuNa - S

nCH2=CH-CH=CH2 + nC6H5-CH=CH2 Dạng bài tập về điều chế, tổng hợp các Polime quan trọng (-CH2-CH=CH-CH2-CH2-CH(C6H5)-)n

5. Cao su cloropren

nCH2=CCl-CH=CH2 Dạng bài tập về điều chế, tổng hợp các Polime quan trọng (-CH2-CCl=CH-CH2-)n

6. Cao su thiên nhiên

Ví dụ minh họa dạng bài tập về điều chế, tổng hợp các Polime quan trọng

Câu 1: Sản phẩm hữu cơ của phản ứng nào sau đây không dùng để chế tạo tơ tổng hợp?

A. trùng hợp vinyl xianua

B. trùng ngưng axit e-aminocaproic

C. trùng hợp metyl metacrylat

D. trùng ngưng hexametylenđiamin với axit ađipic

Đáp án: C

A. Trùng hợp vinyl xianua ⇒ thu được poli acrilonitrin ⇒ chế tạo tơ olon.

B. Trùng hợp axit ε-aminocaproic ⇒ thu được poli caproamit ⇒ chế tạo tơ nilon-6.

C. Trùng hợp metyl metacrylat ⇒ thu được poli (metyl metacrylat) ⇒ chế tạo thủy tinh hữu cơ.

D. Trùng ngưng hexametylenđiamin với axit ađipic ⇒ thu được poli (hexametylen-ađipamit)

Câu 2: Dãy gồm các chất được dùng để tổng hợp cao su Buna-S là:

A. CH2=C(CH3)-CH=CH2, C6H5CH=CH2.


C. CH2=CH-CH=CH2, lưu huỳnh.


Đáp án: B

Cao su Buna-S là sản phẩm của phản ứng đồng trùng hợp butađien và stiren

nCH2=CH−CH=CH2 + nC6H5CH=CH2 → −[CH2−CH=CH−CH2−CH(C6H5)−CH2]−n

Câu 3: Tơ sợi axetat được sản xuất từ:

A. Visco

B. Vinyl axetat

C. Axeton

D. Este của xenlulozơ và anhiđrit axetic

Đáp án: D

Tơ axetat được sản xuất từ xenlulozơ và anhiđrit axetic:

[C6H7O2(OH)3]n + 3n(CH3CO)2O → [C6H7O2(CH3COO)3]n + 3nCH3COOH

Bài tập vận dụng về điều chế, tổng hợp các Polime quan trọng

Bài 1: Tơ nitron (olon) là sản phẩm trùng hợp của monome nào sau đây?





Đáp án: C

Trùng hợp vinyl xianua (CH2=CH−CN) thu được tơ nitron(olon)

Bài 2: Nhựa phenol fomanđehit được tổng hợp bằng phương pháp đun nóng phenol với:

A. CH3COOH trong môi trường axit.

B. HCHO trong môi trường axit.

C. HCOOH trong môi trường axit.

D. CH3CHO trong môi trường axit.

Đáp án: B

Bài 3: Poli(vinyl clorua) được điều chế theo sơ đồ: X → Y → Z → PVC. Chất X là:

A. etan

B. butan

C. metan

D. propan

Đáp án: C

Metan → Axetilen → Vinyl clorua → PVC

Bài 4: Để tạo thành PVA, người ta tiến hành trùng hợp



B. CH2=C(CH3)-COO-CH3.

D. CH3-COO-C(CH3)=CH2.

Đáp án: C

Poli(vinyl axetat) (PVA) được điều chế từ monome: vinyl axetat CH3COOCH=CH2

Bài 5: Monome được dùng để điều chế polietilen là

A. CH2=CH-CH3.

B. CH2=CH2.



Đáp án: B

nCH2 = CH2 Dạng bài tập về điều chế, tổng hợp các Polime quan trọng (-CH2–CH2-)n.

Bài 6: Polime được dùng để chế tạo thuỷ tinh hữu cơ (plexiglas) là

A. poli (metyl acrylat).

B. poli (metyl metacrylat).

C. poli (phenol – fomanđehit).

D. poli (metyl axetat).

Đáp án: B

Thủy tinh hữu cơ(plexigas) được điều chế bằng phản ứng trùng hợp metyl metacrylat [CH2=C(CH3)COOCH3]

Bài 7: Hai chất nào dưới đây tham gia phản ứng trùng ngưng với nhau tạo tơ nilon- 6,6

A. Axit ađipic và etylen glicol

B. Axit picric và hexametylenđiamin

C. Axit ađipic và hexametylenđiamin

D. Axit glutamic và hexaetylenđiamin

Đáp án: C

Đồng trùng ngưng giữa axit ađipic (HOOC−(CH2)4−COOH) và hexametylenđiamin (H2N−(CH2)6−NH2) thu được tơ nilon-6,6

Mời các bạn tham khảo thêm các bài viết dưới đây của chúng tôi:

Trên đây VnDoc đã giới thiệu tới các bạn Dạng bài tập về điều chế, tổng hợp các Polime quan trọng. Để có kết quả cao hơn trong học tập, VnDoc xin giới thiệu tới các bạn học sinh tài liệu Giải bài tập Toán lớp 12, Giải bài tập Hóa học lớp 12, Giải bài tập Vật Lí 12, Tài liệu học tập lớp 12VnDoc tổng hợp và đăng tải.

Đánh giá bài viết
1 613
0 Bình luận
Sắp xếp theo
Chuyên đề Hóa học lớp 12 Xem thêm