Dạng bài tập tính hệ số Polime hóa (Tính số mắt xích)

Chuyên đề Hóa học 12 Dạng bài tập tính hệ số Polime hóa (Tính số mắt xích). Tài liệu sẽ giúp các bạn học sinh giải bài tập Hóa học lớp 12 hiệu quả hơn. Mời các bạn tham khảo.

I. Kiến thức cần nhớ dạng bài tập tính hệ số Polime hóa

*Phương pháp giải

  • Số mắt xích = số phân tử monome = hệ số polime hóa (n) = 6,02.1023 số mol mắt xích

(Lưu ý: số mắt xích phải là số tự nhiên, nếu lẻ phải làm tròn)

  • Hệ số polime hóa (n) = hệ số trùng hợp Dạng bài tập tính hệ số Polime hóa (Tính số mắt xích)
  • Loại polime (dựa vào phân tử khối) và số lượng polime (dựa vào nhóm chức)
  • Các loại polime thường gặp:
Tên gọiCông thứcPhân tử khối (M)
Poli vinylclorua (PVC)(-CH2–CHCl-)n62,5n
Poli etilen (PE)(-CH2–CH2-)n28n
Cao su thiên nhiên[-CH2–C(CH3)=CH-CH2-]n68n
Cao su clopren(-CH2-CCl=CH-CH2-)n88,5n
Cao su buna(-CH2-CH=CH-CH2-)n54n
Poli propilen (PP)[-CH2-CH(CH3)-]n42n

II. Ví dụ minh họa dạng bài tập tính hệ số Polime hóa

Ví dụ 1: Phân tử khối trung bình của polietilen X là 420000. Hệ số polime hoá của PE là:

Hướng dẫn giải

PE là (CH2-CH2)n có M = 420000 = 28n

⇒ n = 15.000 (hệ số polime hóa)

Ví dụ 2: Clo hoá PVC thu được một polime chứa 63,96% clo về khối lượng, trung bình 1 phân tử clo phản ứng với k mắt xích trong mạch PVC. Giá trị của k là?

Hướng dẫn giải

Mắt xích PVC là C2H3Cl ⇒ k mắt xích trong mạch PVC có công thức là C2kH3kClk

C2kH3kClk + Cl2 → C2kH3k-1Clk+1 + HCl

⇒ %Cl = Dạng bài tập tính hệ số Polime hóa (Tính số mắt xích) = 63,96%

⇒ k = 3

Ví dụ 3: Một polime X được xác định có phân tử khối là 39026,5 đvC với hệ số trùng hợp để tạo nên polime này là 625. Polime X là?

Hướng dẫn giải

Polime có Mmắt xích = Dạng bài tập tính hệ số Polime hóa (Tính số mắt xích) = 62,5 ⇒ Dấu hiệu của nguyên tố clo.

Gọi công thức X là CxHyCl ⇒ 12x + y = 27

⇒ X có công thức là C2H3Cl ⇔ CH2=CHCl

Ví dụ 4. Khối lượng phân tử của tơ capron là 15000 đvC. Số mắt xích trung bình trong phân tử của loại tơ này gần nhất là

A. 145.

B. 133.

C. 118.

D. 113.

Hướng dẫn giải

Cấu tạo của tơ capron:

-(-HN-(CH2)5-CO-)n-

→ 113n = 15000

→ a =132, 7

→ Đáp án: B

Ví dụ 5. Polime X có hệ số trùng hợp là 560 và phân tử khối là 35000. Công thức một mắt xích của X là

A. (CH2–CHCl) n.

B. (CH=CCl) n .

C. (CCl=CCl) n .

D. (CHCl–CHCl) n.

Hướng dẫn giải

Khối lượng của một mắt xích trong polime X là: M = 35000/560 = 62,5

→ công thức của mắt xích là  (CH2–CHCl) n.

→ Đáp án: A

Ví dụ 6: Số mắt xích glucozơ có trong 194,4 mg amilozơ là (cho biết số Avogađro = 6,02.1023):

A. 7224.1017.

B. 6501,6.1017.

C. 1,3.10-3.

D. 1,08.10-3.

Hướng dẫn giải 

Amilozơ là một thành phân cấu tạo nên tinh bột, amilozơ là polime có mạch không phân nhánh, do nhiều mắt xích a-glucozơ –C6H10O5– liên kết với nhau tạo thành.

n(C6H10O5)n = 194,4/1000.162 mol

số mắc xích n = 194,4.6,02.1023/1000.162 = 7224.1017

→ Đáp án: A

III. Bài tập vận dụng tính hệ số Polime hóa

1. Bài tập có đáp án 

Bài 1: Khối lượng của một đoạn nilon – 6,6 là 27346 đvC và một đoạn mạch tơ capron là 17176 đvC. Số lượng mắt xích trong đoạn mạch của 2 polime nêu trên lần lượt là?

A. 113 và 152

B. 121 và 114

C. 121 và 152

D. 113 và 114

Đáp án: C

M-[HN-(CH2)6-NH-OC-(CH2)4-CO]-n = 27346 đvC

→ 226n = 27346 → n = 121.

M-[NH(CH2)5CO]-n= 17176 đvC

→ 113n = 17176 → n = 152.

Bài 2: Một đoạn tơ nilon – 6,6 có khối lượng 7,5g thì số mắt xích trong đoạn tơ đó là?

A. 0,133.1022

B. 1,99. 1022

C. 1,6. 1015

D. 2,5. 1016

Đáp án: B

Tơ nilon-6,6: [-HN-(CH2)6-NH-OC-(CH2)4-CO-]n

→ Số mắt xích: n = (7,5/226).6,023.1023

→ n = 1,99.1022

Bài 3: Hệ số trùng hợp của poli(etylen) là bao nhiêu nếu trung bình một phân tử polime có khối lượng khoảng 120 000 đvC?

A. 4280

B. 4286

C. 4281

D. 4627

Đáp án: B

Polime: (C2H4)n có M = 120000 = 28n → n = 4286

Bài 4: Tính khối lượng trung bình của một phân tử cao su poli isopren, biết số mắt xích trung bình là 700?

A. 45600

B. 47653

C. 47600

D. 48920

Đáp án: C

n = (mpolime)/(mmonome) → mpoli isopren = 700. 68 = 47600

Bài 5: Một polime có phân tử khối là 28000 đvC và hệ số polime hóa là 10000. Polime ấy là:

A. PE

B. PVC

C. PP

D. teflon

Đáp án: A

Phân tử khối của một mắt xích là 28000 : 10000= 28 (C2H5)

Vậy polime là PE (polietilen)

Bài 6: Khi clo hoá PVC ta thu được một loại tơ clorin có chứa 66,7% clo về khối lượng. Hỏi trung bình một phân tử clo tác dụng với bao nhiêu mắt xích PVC?

A. 4

B. 1

C. 3

D. 2

Đáp án: D

PVC hay Poli (vinyl clorua) là (C2H3Cl)n hay C2nH3nCln.

1 mắt xích ứng với n = 1 ⇒ CT của 1 mắt xích: C2H3Cl.

kC2H3Cl + Cl2 → C2kH3k–1Clk+1 + HCl.

⇒ %mCl = Dạng bài tập tính hệ số Polime hóa (Tính số mắt xích) .100% = 66,7% ⇒ k ≈ 2.

⇒ trung bình 1 phân tử Cl2 tác dụng với 2 mắt xích

Bài 7: Polime được trùng hợp từ etilen. Hỏi 280g polietilen đã được trùng hợp từ tối thiểu bao nhiêu phân tử etilen?

A. 3,01.1024

B. 6,02.1024

C. 6,02.1023

D. 10

Đáp án: B

Số phân tử etilen tối thiểu: (280/28). 6,2.1023 = 6,02.1024

Bài 8: Trùng hợp propilen thu được polipropilen (PP). Nếu đốt cháy toàn 1 mol polime đó thu được 13200 gam CO2. Hệ số trùng hợp n của polime đó là:

A. 120

B. 92

C. 100

D. 140

Đáp án: C

PP có công thức (C3H6)n

(C3H6)n + 4,5 O2 → 3nCO2 + 3nH2O

Khi đốt cháy 1 mol PP sinh ra 3n mol CO2 → 3n = 300 → n = 100

2. Bài tập tự luyện 

Câu 1. Khối lượng phân tử của 1 loại tơ capron bằng 16950 đvC, của tơ enang bằng 21590 đvC. Số mắt xích trong công thức phân tử của mỗi loại tơ trên lần lượt là:

A. 150 và 170.

B. 170 và 180.

C. 120 và 160.

D. 200 và 150.

Xem đáp án
Đáp án A

Phân tử khối 1 mắt xích của tơ capron = 113, của tơ enang = 127

Tìm mắt xích chỉ cần lấy khối lượng phân tử chia cho phân tử khối của 1 mắt xích

=> 150 và 170

Câu 2. Trong 1 kg gạo chứa 81% tinh bột có số mắt xích tinh bột là

A. 3,011.1024.

B. 5,212.1024.

C. 3,011.1021.

D. 5,212.1021.

Xem đáp án
Đáp án A

Số mắt xích là: 100/162.6,02.1023  .0.81% =3,01.1024

Câu 3. Đun polime X với Br2/Fe thấy sinh ra một chất khí không màu có thể làm kết tủa dung dịch AgNO3. Nếu đun khan X sẽ thu được một chất lỏng Y (dY/kk = 3,586). Y không những tác dụng với Br2/Fe mà còn tác dụng được với nước Br2. Công thức cấu tạo của Y là

A. C6H5–CH3.

B. C6H5–CH=CH2.

C. C6H5–C≡CH.

D. C6H11–CH=CH2.

Xem đáp án
Đáp án B

Polime X + Br2/Fe →  ↑ khí không màu. Khí không màu + AgNO3 → kết tủa

=> X là polime có chứa vòng C6H5-

Đun khan X sẽ thu được một chất lỏng Y (nY)

Theo đề bài: MY = 104

Y có dạng C6H5-R → MR = 104 - (12.6 + 5) = 27 => R là C2H3-

Mà Y + Br2/Fe, + Br2 → Y là C6H5–CH=CH2=> đáp án đung là đáp án B

Câu 4. Đun hỗn hợp gồm acrilonitrin và ankađien liên hợp X (tỉ lệ mol 1:1) thu được polime Y. Trong Y có 78,505% khối lượng cacbon. Công thức của Y là

A. –(–CH2–C(CH3)=CH–CH2–CH2–CH(CN)–)n –.

B. –(–CH2–CH=CH–CH2–CH2–CH(CN)–)n-.

C. –(–CH2–C(CH3)=C(CH3)–CH2–CH2–CH(CN)–)n-

D. –(–CH2–CH2–CH2–CH2–CH2–CH(CN)–)n–.

Xem đáp án
Đáp án B

Câu 5. Khi tiến hành phản ứng trùng ngưng giữa axit ađipic và hexametylenđiamin ta thu được một tơ nilon-6,6 chứa 12,39% nitơ về khối lượng. Tỉ lệ số mắt xích giữa axit ađipic và hexametilenđiamin trong mẫu tơ trên là

A. 1:3

B. 1:1

C. 2:3

D. 3:2

Xem đáp án
Đáp án B

Tơ có dạng (-NH-C6H12-NH-)(-CO-C4H8-CO-)x

\%N = \frac{28}{112x + 114}.100\% = 12,39\%

→ x = 1

→ Tỷ lệ axit ađipic: hexametylenđiamin = x:1 = 1:1

Câu 6: Một loại cao su chứa 2% S. Hỏi cứ bao nhiêu mắt xích izopren thì có một cầu nối ddiissunfua –S-S-?

A. 46

B. 64

C. 80

D. 40

Xem đáp án

Đáp án B

Sơ đồ: (C5H8)n + S2 → C5nH8n -2S2

Tỷ lệ % đisunfua (64.100)/(68n+62) = 2%

=> n = 46

Câu 7: Tiến hành clo hoá poli (vinyl clorua) thu được một loại polime X dùng để điều chế tơ clorin. Trong X có chứa 66,18% clo theo khối lượng. Vậy, trung bình có bao nhiêu mắt xích PVC phản ứng được với một phân tử clo?

A. 1

B. 2

C. 3

D. 4

Xem đáp án

Đáp án B

Gọi n là số mắt xích PVC và x là số phân tử Clo

(C2H3Cl)n + xCl2 → C2nH(3n-x)Cl(n+x) + xHCl

Ta có:

\frac{35,5\left(n + x\right)}{62,5n - 34,5x}.100\% = 66,18\%

Quy đồng rồi biến đổi PT trên ta tìm được:

n = 2,16x

Đề bài hỏi là "Hỏi trung bình có bao nhiêu mắt xích PVC kết hợp với 1 phân tử clo”

x = 1 (số phân tử clo)

=> n = 2,16 ≈ 2.

Câu 8: Cứ 5,668 g cao su buna-S phản ứng vừa hết với 3,462 g brom trong CCl4. Tỉ lệ mắt xích butađien và stiren trong cao su buna-S là:

A. 1:3

B. 1:2

C. 2:3

D. 3:5

Xem đáp án
Đáp án B

Cao su buna-S có dạng [-CH2CH=CHCH2-CH2CH(C6H5)]n.

⇒ dù trùng hợp theo tỉ lệ nào thì Br2 chỉ cộng vào gốc butađien.

⇒ nbutađien = nBrom ≈ 0,022 mol ⇒ nstiren = (5,688 – 0,022 × 54) : 104 = 0,043 mol.

nbutađien : nstiren = 0,022 : 0,043 ≈ 1 : 2

Câu 9: Clo hoá PVC thu được một polime chứa 63,96% clo về khối lượng, trung bình 1 phân tử clo phản ứng với k mắt xích trong mạch PVC. Giá trị của k là

A. 4

B. 6

C. 5

D. 3

Xem đáp án
Đáp án D

Trung bình 1 phân tử clo phản ứng với k mắt xích trong mạch PVC

C2k­H3kClk + Cl2 → C2kH3k-1Clk+1 + HCl

Theo bài ta có:

\frac{35,5k + 35,5}{62,5k + 34,5}.100\% = 63,96\%

⇔ k=3

Cứ 3 mắt xích PVC tác dụng với 1 phân tử Cl2

Câu 10. Đốt cháy hoàn toàn 1 lượng cao su buna-S với lượng không khí vừa đủ, thấy tạo một hỗn hợp khí ở nhiệt độ 127oC mà trong đó N2 chiếm 76,36% về thể tích (giả sử không khí chỉ chứa oxi và nitơ theo tỉ lệ thể tích là 1:4). Tỉ lệ số mắt xích butađien và stiren trong polime này là ?

A. 2:1

B. 3:2

C. 2:3

D. 3:4

Xem đáp án
Đáp án A

Giả sử cao su có dạng:

(C4H6)m(C8H8)n + (5,5m+10n) O2 → (4m+8n) CO2 + (3m+4n) H2O

1 mol 5,5m + 10n 4m + 8n 3m + 4n

=> nN2 = 4nO2 pứ = 22m + 40n

Khí sau phản ứng gồm : (22m + 40n) mol N2; (4m + 8n) mol CO2; (3m + 4n) mol H2O

Có %VN2 = 76,36% => (22m + 40n)/(29m + 52n) = 0,7636

=> m : n = 2 : 1

Câu 11. Một polime Y có cấu tạo như sau :

… –CH2–CH2–CH2–CH2–CH2–CH2–CH2–CH2–CH2– …

Công thức một mắt xích của polime Y là :

A. –CH2–CH2–CH2– .

B. –CH2–CH2–CH2–CH2– .

C. –CH2– .

D. –CH2–CH2– .

Xem đáp án
Đáp án D

Để làm được loại câu hỏi này, ta cần xác định được monome của polime.

Từ cấu tạo của Y ta nhận thấy, monome của Y là CH2=CH2

=> 1 mắt xích của chất Y có công thức là: –CH2–CH2

Câu 12. Tiến hành clo hóa poli(vinyl clorua) thu được một loại polime X dùng để điều chế tơ clorin. Trong X có chứa 66,18% clo theo khối lượng. Vậy trung bình có bao nhiêu mắt xích PVC phản ứng được với một phân tử clo?

A. 1.

B. 2.

C. 3.

D. 4.

Xem đáp án
Đáp án B

Đặt a là số mắt xích –CH2–CHCl– hay –C2H3Cl– tham gia phản ứng với một phân tử Cl2. Do PVC không có liên kết bội, nên chỉ phản ứng thế với Cl2 :

C2aH3aCla + Cl2 → C2aH3a-1Cla+1 + HCl

%Cl = [35,5(a + 1)]/[24a + (3a − 1) + 35,5/(a + 1)]= 66,18/100 ⇒ a = 2.

.......................................

Mời các bạn tham khảo thêm các bài viết dưới đây của chúng tôi:

Trên đây VnDoc.com vừa giới thiệu tới các bạn Dạng bài tập tính hệ số Polime hóa (Tính số mắt xích), mong rằng qua đây các bạn có thể học tập tốt hơn môn Hóa học nhé. Mời các bạn cùng tham khảo thêm kiến thức các môn Toán 12, Tiếng Anh 12, Ngữ văn 12, đề thi học kì 1 lớp 12, đề thi học kì 2 lớp 12...

Ngoài ra, VnDoc.com đã thành lập group chia sẻ tài liệu học tập THPT miễn phí trên Facebook: Tài liệu học tập lớp 11 Mời các bạn học sinh tham gia nhóm, để có thể nhận được những tài liệu mới nhất.

Đánh giá bài viết
4 36.135
0 Bình luận
Sắp xếp theo
Chuyên đề Hóa học lớp 12 Xem thêm