Dạng bài tập các phản ứng hóa học của Este

Chuyên đề Hóa học 12 Dạng bài tập các phản ứng hóa học của Este đã được VnDoc tổng hợp. Mời các bạn học sinh tham khảo để rèn luyện giải Hóa 12 hiệu quả hơn.

Hóa học 12: Dạng bài tập các phản ứng hóa học của Este

Lý thuyết

1. Phản ứng của nhóm chức este

- Thủy phân este trong môi trường axit là phản ứng nghịch với phản ứng este hóa:

R–COO–R’ + H–OH Dạng bài tập các phản ứng hóa học của Este R–COOH + R’–OH

- Phản ứng thủy phân trong môi trường kiềm là phản ứng một chiều và còn được gọi là phản ứng xà phòng hóa:

R–COO–R’ + NaOH Dạng bài tập các phản ứng hóa học của Este R–COONa + R’–OH

Chú ý: Nếu este dạng lipit (chất béo) khi xà phòng hóa, ta thu được glixerol C3H5(OH)3 và xà phòng.

(RCOO)3C3H5 + 3NaOH Dạng bài tập các phản ứng hóa học của Este C3H5(OH)3 + 3RCOONa

2. Phản ứng khử este

Este bị khử bởi liti nhôm hiđrua (LiAlH4), khi đó nhóm RCO– (gọi là nhóm axyl) trở thành ancol bậc I:

R–COO–R’ Dạng bài tập các phản ứng hóa học của Este R–CH2–OH + R’–OH

3. Phản ứng ở gốc hiđrocacbon

Este có thể tham gia phản ứng thế, cộng, tách, trùng hợp,… Sau đây chỉ xét phản ứng cộng và phản ứng trùng hợp.

- Phản ứng cộng vào gốc không no: Gốc hiđrocacbon không no ở este có phản ứng cộng với H2, Br2, Cl2, … giống hiđrocacbon không no.

Ví dụ :

CH3[CH2]7CH=CH[CH2]7COOCH3 + H2 Dạng bài tập các phản ứng hóa học của Este CH3[CH2]16COOCH3

CH3[CH2]7CH=CH[CH2]7COOCH3: metyl oleat

CH3[CH2]16COOCH3: metyl stearat

- Phản ứng trùng hợp: Một số este đơn giản có liên kết C = C tham gia phản ứng trùng hợp giống như anken.

- Este của axit fomic HCOOR’ có các tính chất của andehit: phản ứng tráng gương, phản ứng tạo kết tủa đỏ gạch với Cu(OH)2

4. Phản ứng đốt cháy este

RCOOR’ + O2 Dạng bài tập các phản ứng hóa học của Este CO2 + H2O

Nếu Dạng bài tập các phản ứng hóa học của Este thì este là no, đơn chức ⇒ CTTQ là: CnH2nO2

5. Phản ứng este hóa (Phản ứng điều chế este)

RCOOH + R’OH Dạng bài tập các phản ứng hóa học của Este R–COO–R’ + H2O

Ví dụ:

CH3COOH + C2H5OH Dạng bài tập các phản ứng hóa học của Este CH3COOC2H5 +H2O

Đặc biệt: Điều chế este của phenol phải dùng anhidrit axit hoặc clorua axit


Ví dụ minh họa

Ví dụ 1: Cho sơ đồ sau: CH2=CH2 Dạng bài tập các phản ứng hóa học của Este X → Y Dạng bài tập các phản ứng hóa học của Este Z

Vậy chất Z là?

Lời giải

CH2=CH2 + H2O Dạng bài tập các phản ứng hóa học của Este CH3CH2OH (X)

CH3CH2OH + O2 Dạng bài tập các phản ứng hóa học của Este CH3COOH (Y) + H2O

CH3COOH + CH3CH2OH Dạng bài tập các phản ứng hóa học của Este CH3COOC2H5 (Z) + H2O

Ví dụ 2: Metyl acrylat được điều chế từ axit và rượu nào?

A. CH2=C(CH3)COOH và C2H5OH.





Đáp án D

Metyl acrylat: CH2=CHCOOCH3


Ví dụ 3: Thủy phân este C4H6O2 (xúc tác axit) được hai chất hữu cơ X, Y. Từ X có thể điều chế trực tiếp ra Y. Vậy X là:

A. anđehit axetic.

B. ancol etylic.

C. axit axetic.

D. axit fomic.


Đáp án A

CH3COOCH=CH2 + H2O Dạng bài tập các phản ứng hóa học của Este CH3COOH + CH3CHO

Dạng bài tập các phản ứng hóa học của Este

Bài tập vận dụng

Câu 1. Cho sơ đồ điều chế chất E từ metan như sau:

Dạng bài tập các phản ứng hóa học của Este

Vậy chất E là:





Đáp án

Dạng bài tập các phản ứng hóa học của Este

Câu 2. Propyl fomat được điều chế từ

A. axit fomic và ancol metylic.

B. axit fomic và ancol propylic.

C. axit axetic và ancol propylic.

D. axit propionic và ancol metylic.

Đáp án B

Propyl fomat: HCOOC3H7


Câu 3. Cho phản ứng: CH3CH2COOCH=CH2 + H2O Dạng bài tập các phản ứng hóa học của Este

Sản phẩm thu được từ phản ứng trên gồm:





CH3CH2COOCH=CH2 + H2O Dạng bài tập các phản ứng hóa học của Este CH3CH2COOH + CH2=CH-OH

Vì CH2=CH-OH kém bền nên sẽ biến thành CH3CHO

Câu 4. Cho sơ đồ chuyển hoá sau:

1) C3H4O2 + NaOH → (A) + (B)

2) (A) + H2SO4 loãng → (C) + (D)

3) (C) + AgNO3 + NH3 + H2O → (E) + Ag↓ + NH4NO3

4) (B) + AgNO3 + NH3 + H2O → (F) + Ag↓ + NH4NO3

Các chất B và A có thể là:





Đáp án A


(2) HCOONa + H2SO4 → HCOOH + Na2SO4

(3) HCOOH + AgNO3 + NH3 + H2O → (NH4)2CO3 + Ag + NH4NO3

(4) CH3CHO + AgNO3 + NH3 + H2O → CH3COONH4 + Ag + NH4NO3

Câu 5. Thủy phân este E có công thức phân tử C4H8O2 với xúc tác axit vô cơ loãng, thu được hai sản phẩm hữu cơ X, Y (chỉ chứa các nguyên tử C, H, O). Từ X có thể điều chế trực tiếp ra Y bằng một phản ứng duy nhất. Chất X là:

A. Axit axetic

B. Rượu etylic

C. Etyl axetat

D. Axit fomic

Đáp án B

Ta thấy: CH3COOC2H5 + H2O Dạng bài tập các phản ứng hóa học của Este CH3COOH + C2H5OH

C2H5OH + O2 Dạng bài tập các phản ứng hóa học của Este CH3COOH + H2O

Vậy X là C2H5OH

Câu 6. Cho dãy chuyển hóa sau:

Phenol Dạng bài tập các phản ứng hóa học của Este Phenyl axetat Dạng bài tập các phản ứng hóa học của Este Y (hợp chất thơm)

Hai chất X, Y trong sơ đồ trên lần lượt là:

A. anhidrit axetic, phenol

B. anhidrit axetic, natri phenolnat

C. axit axetic, natri phenolnat

D. axit axetic, phenol

Đáp án B

Các PTHH xảy ra:

Dạng bài tập các phản ứng hóa học của Este

Vậy X là anhidrit axetic: (CH3CO)2O, Y là natri phenolnat: C6H5ONa

Mời các bạn tham khảo thêm các bài viết dưới đây của chúng tôi:

Trên đây VnDoc đã giới thiệu tới các bạn Dạng bài tập các phản ứng hóa học của Este. Để có kết quả cao hơn trong học tập, VnDoc xin giới thiệu tới các bạn học sinh tài liệu Giải bài tập Toán lớp 12, Giải bài tập Hóa học lớp 12, Giải bài tập Vật Lí 12, Tài liệu học tập lớp 12VnDoc tổng hợp và đăng tải.

Đánh giá bài viết
1 419
0 Bình luận
Sắp xếp theo
Chuyên đề Hóa học lớp 12 Xem thêm