Các phản ứng thủy phân Peptit và Protein

1 48

Chuyên đề Hóa học 12 Các phản ứng thủy phân Peptit và Protein. Nội dung tài liệu sẽ giúp các bạn giải Hóa học 12 chính xác hơn. Mời các bạn tham khảo.

Phản ứng thủy phân:

- Điều kiện thủy phân: xúc tác axit hoặc kiềm và đun nóng hoặc xúc tác enzim

- Sản phẩm: các α-amino axit

I. Thủy phân hoàn toàn

1. Thủy phân trong môi trường trung tính (xt: enzym)

Khi thủy phân hoàn toàn peptit (hoặc protein đơn giản) bằng xúc tác enzym, ta thu được hỗn hợp các ∝-amino axit ban đầu.

Các phản ứng thủy phân Peptit và Protein

Ví dụ: Gly-Gly-Gly + 2H2O → 3H2N-CH2-COOH

Phương pháp giải:

1/ npeptit + n_{H_2O} = n α-amino axit

2/ mpeptit + m_{H_2O} = m α-amino axit

2. Thủy phân trong môi trường axit

Peptit (n mắt xích) + (n – 1)H2O + aHCl → n muối của ∝-amino axit

(với a là số nguyên tử N trong X)

Ví dụ: Gly-Gly-Lys + 2H2O + 4HCl → 2ClH3N-CH2-COOH + ClH3N-[CH2]4-CH(NH3Cl)-COOH

Phương pháp giải:

+ Tính số mol các chất theo hệ số cân bằng sau đó sử dụng bảo toàn khối lượng:

mpeptit + m_{H_2O} + mHCl = mmuối

+ Bảo toàn gốc ∝-amino axit:

Ví dụ với phương trình trên:

n_{ClH_3N-CH_2-COOH} = 2.ngly-gly-lysn_{ClH_3N-(CH_2)_4-CH(NH_3Cl)-COOH} = ngly-gly-lys

3. Thủy phân trong môi trường kiềm

Peptit (n mắt xích) + (n - 1 + b)NaOH → n muối của ∝-amino axit + bH2O

Trong đó: b là tổng số nhóm COOH còn tự do trong peptit (các nhóm COOH không tạo liên kết peptit)

Ví dụ: Gly-Glu-Gly có CTCT:

Các phản ứng thủy phân Peptit và Protein

→ số nhóm COOH còn tự do trong peptit là b = 2

PTHH: Gly-Glu-Gly + 4NaOH → 2H2N-CH2-COONa + NaOOC-[CH2]2-CH(NH2)-COONa + 2H2O

Phương pháp giải:

+ Tính số mol các chất theo hệ số cân bằng sau đó sử dụng bảo toàn khối lượng: mpeptit + mNaOH = mmuối + m_{H_2O}

+ Bảo toàn gốc ∝-amino axit

II. Thủy phân không hoàn toàn

Khi thủy phân không hoàn toàn peptit thì chúng ta thu được hỗn hợp các amino axit và các oligopeptit.

Ví dụ: Thủy phân không hoàn toàn Ala-Gly-Gly-Ala-Glu ta có thể thu được hỗn hợp các chất gồm Ala, Glu, Gly, Gly-Ala- Glu, Ala-Gly-Gly, …

Phương pháp giải:

+ Bảo toàn mắt xích của mỗi loại amino axit.

Ví dụ: nAla-Ala-Gly = nGly = ½.nAla

+ Bảo toàn khối lượng.

Ví dụ minh họa

Câu 1: Thủy phân hoàn toàn 143,45 gam hỗn hợp A gồm hai tetrapeptit thu được 159,74 gam hỗn hợp X gồm các Aminoaxit (Các Aminoacid chỉ chứa 1nhóm -COOH và 1 nhóm -NH2). Cho tòan bộ X tác dụng với dung dịch HCl dư, sau đó cô cạn dung dịch thì nhận được m(gam) muối khan. Tính khối lượng nước phản ứng và giá trị của m lần lượt bằng?

A. 8,145(g) và 203,78(g).

B. 32,58(g) và 10,15(g).

C. 16,2(g) và 203,78(g).

D. 16,29(g) và 203,78(g).

Đặt Công thức chung cho hỗn hợp A là H[NHRCO]4OH

Ta có phản ứng: H[NHRCO]4OH + 3H2O → 4H2NRCOOH

Các phản ứng thủy phân Peptit và Protein

→ Đáp án D

Câu 2: Thủy phân hoàn toàn 14,6g Gly-Ala trong dung dịch HCl dư, thu được m gam muối. Giá trị của m là:

A. 11,15 g

B. 12,55 g

C. 18,6 gam

D. 23,7 gam.

Công thức Gly- Ala: H2NCH2CONHCH(CH3)COOH.

M Gly-Ala= M Gly + Mala – 18.(2-1) = 75 + 89 -18 = 146

Các phản ứng thủy phân Peptit và Protein

Ta có m muối = mpeptit + m_{H_2O} + mHCl= 14,6 + 0,1.18 + 0,2. 36,5 = 23,7 g

→ Đáp án D

Câu 3: Thủy phân hoàn toàn 14,6 g Gly-Ala trong dung dịch NaOH dư, thu được m gam muối. Giá trị của m là:

A. 16,8g

B. 22,6g

C.18,6g

D. 20,8g

Gly-Ala + 2NaOH → muối + H2O

0,1      0,2      0,1 mol

Ta có: m muối = m peptit + m NaOH – m H2O= 14,6 + 0,2.40 – 0,1.18 = 20,8 g.

→ Đáp án D

III. Bài tập phản ứng thủy phân Peptit và Protein

Câu 1: X là một Tetrapeptit cấu tạo từ Aminoacid A, trong phân tử A có 1 nhóm(-NH2), 1 nhóm (-COOH), no, mạch hở. Trong A Oxi chiếm 42,67% khối lượng. Thủy phân m gam X trong môi trường acid thì thu được 28,35(g) tripeptit; 79,2(g) đipeptit và 101,25(g) A. Giá trị của m là?

A. 184,5.

B. 258,3.

C. 405,9.

D. 202,95.

Từ % khối lượng Oxi trong A ta xác định được A là Gli (H2NCH2COOH) với M=75

⇒ Công thức của Tetrapeptit là H[NHCH2CO]4OH với

M= 75.4 – 3.18 = 246g/mol

Các phản ứng thủy phân Peptit và Protein

Đặt mắt xích NHCH2CO = X

Có sơ đồ phản ứng:

Các phản ứng thủy phân Peptit và Protein

⇒ Số mol X phản ứng là: 0,15 + 0,3 + 0,3 = 0,75mol

⇒ m = 0,75. 246 =184,5(g)

→ Đáp án A

Câu 2: Thủy phân hết m gam tetrapeptit Ala-Ala-Ala-Ala mạch hở thu được hỗn hợp gồm: 28,48 gam Ala; 32 gam Ala-Ala; 27,72 gam Ala-Ala-Ala. Giá trị của m là:

A. 90,6.

B. 111,74.

C. 81,54.

D. 66,44

Áp dụng định luật bảo toàn gốc Ala ta có:

Các phản ứng thủy phân Peptit và Protein

⇒ ntetrapeptit = 0,27 → m= 0,27.302 = 81,54

→ Đáp án

Câu 3:: Đun nóng m gam hỗn hợp gồm a mol tetrapeptit mạch hở X và 2a mol tripeptit mạch hở Y với 600 ml dung dich NaOH 1M vừa đủ. Sau khi các phản ứng kết thúc, cô cạn dung dịch thu được 72,48 gam muối khan của các amino axit đều có một nhóm -COOH và một nhóm -NH2 trong phân tử. Giá trị của m là:

A. 51,72.

B. 54,30.

C. 66,00.

D. 44,48.

X + 4NaOH → 4Muối + H2O

a     4a      a

Y + 3NaOH → 3Muối + H2O

2a   6a       2a

Ta có: nNaOH= 10a = 0,6 → a = 0,06 mol

BTKL: m + 0,6.40 = 72,48 + 0,18.18 ⇒ m= 51,72 gam

→ Đáp án A

Câu 4: Thủy phân hoàn toàn 1 mol peptit mạch hở X, thu được 2 mol Gly, 2 mol Ala và 1 mol Val. Mặt khác, thủy phân không hoàn toàn X, thu được hỗn hợp các amino axit và các peptit (trong đó có Gly-Ala-Val). Số công thức cấu tạo phù hợp với tính chất của X là

A. 5.

B. 4.

C. 3.

D. 6.

X là (Gly)2(Ala)2(Val), trong X có đoạn mạch Gly-Ala-Val nên X có các cấu tạo:

Gly-Ala-Val-Gly-Ala

Gly-Ala-Val-Ala-Gly

Gly-Gly-Ala-Val-Ala

Ala-Gly-Ala-Val-Gly

Gly-Ala-Gly-Ala-Val

Ala-Gly-Gly-Ala-Val

→ Đáp án D

Câu 5: Cho X là hexapeptit, Ala-Gly-Ala-Val-Gly-Val và Y là tetrapeptit Gly-Ala-Gly-Glu. Thủy phân hoàn toàn m gam hỗn hợp gồm X và Y thu được 4 amino axit, trong đó có 30 gam glyxin và 28,48 gam alanin. Giá trị của m là

A. 77,6

B. 83,2

C. 87,4

D. 73,4

Đặt x, y là số mol X, Y

Bảo toàn Gly → nGly = 2x + 2y = 0,4 mol

Bảo toàn Ala → nAla = 2x + y = 0,32 mol

→ x = 0,12 và y = 0,08

→ m = 472x + 332y = 83,2g

→ Đáp án B

Mời các bạn tham khảo thêm các bài viết dưới đây của chúng tôi:

Trên đây VnDoc đã giới thiệu tới các bạn Các phản ứng thủy phân Peptit và Protein. Để có kết quả cao hơn trong học tập, VnDoc xin giới thiệu tới các bạn học sinh tài liệu Giải bài tập Toán lớp 12, Giải bài tập Hóa học lớp 12, Giải bài tập Vật Lí 12, Tài liệu học tập lớp 12VnDoc tổng hợp và đăng tải.

Đánh giá bài viết
1 48
Chuyên đề Hóa học lớp 12 Xem thêm