NH2C3H5(COOH)2 + NaOH → NH2C3H5(COONa)2 + H2O

NH2C3H5(COOH)2 + NaOH → NH2C3H5(COONa)2 + H2O được VnDoc biên soạn hướng dẫn các bạn học sinh viết và cân bằng phương trình phản ứng axit glutamic tác dụng với NaOH. Hy vọng với nội dung Axit glutamic tác dụng với NaOH giúp bạn đọc biết cách vận dụng làm các dạng bài tập câu hỏi liên quan đến phương trình phản ứng. Mời các bạn tham khảo.

1. Phương trình phản ứng Axit glutamic tác dụng NaOH

NH2C3H5(COOH)2 + 2NaOH → NH2C3H5(COONa)2 + 2H2O

Trong phân tử axit glutamic HOOC(CH2)2CH(NH2)COOH có chứa -COOH (tính axit) và nhóm - NH2 (tính bazơ)

⇒ Axit glutamic là chất có tính lưỡng tính

2. Điều kiện phản ứng  axit glutamic tác dụng NaOH

Nhiệt độ thường

3. Bài tập vận dụng liên quan 

Câu 1. Cho axit glutamic tác dụng vừa đủ với 200ml dung dịch NaOH 1M, sau phản ứng thu được a gam muối. Tính giá trị m?

Đáp án hướng dẫn giải chi tiết 

Ta có: nNaOH = 0,2.1 = 0,2 mol

Phương trình hóa học:

H2NC3H5(COOH)2 + 2NaOH → H2NC3H5(COONa)2 + 2H2O

Theo phương trình hóa học

nH2NC3H5(COONa)2 = nH2NC3H5(COOH)2 = 1/2nNaOH = 0,1 mol

và m = mH2NC3H5(COOH)2 = 0,1.147 = 14,7 gam

Câu 2. Cho a gam axit glutamic tác dụng với NaOH vừa đủ cô cạn thu được (a + 4,4) gam chất rắn. Nếu cho a gam axit glutamic tác dụng vừa đủ với dung dịch HCl, khối lượng HCl cần dùng là bao nhiêu?

Đáp án hướng dẫn giải chi tiết 

Phương trình phản ứng hóa học

HOOC-CH2-CH2-CH(NH2)-COOH → NaOOC-CH2-CH2-CH(NH2)-COONa

1 mol                                                 1 mol → mtăng = 2.23 - 2.1 = 44 gam

0,1 mol ← mtăng = 4,4 gam

Khi cho Glutamic phản ứng với HCl, do glutamic có 1 nhóm -NH2 nên ta có:

nHCl = nGlu = 0,1 mol => mHCl = 0,1.36,5 = 3,65 gam

Câu 3. Cho 0,225 mol H2NC3H5(COOH)2 (axit glutamic) vào 275 ml dung dịch HCl 1M thu được dung dịch X. Cho NaOH dư vào dung dịch X. Sau khi các phản ứng xảy ra hoàn toàn, số mol NaOH đã phản ứng là :

Đáp án hướng dẫn giải

X + NaOH = (Glutamic + HCl) + NaOH

Phương trình phản ứng hóa học

H2NC3H5(COOH)2 + 2NaOH → H2NC3H5(COONa)2 + 2H2O

0,225 → 0,45 mol

HCl + NaOH → NaCl + H2O

0,275 → 0,275

=> nNaOH = 0,45 + 0,275 = 0,725 mol

Câu 4. Amin Y chứa 1 nhóm -COOH và 2 nhóm -NH2. Cho 1 mol Y tác dụng hết với dung dịch HCl thu được 205 gam muối khan. Tìm công thức phân tử của Y.

Đáp án hướng dẫn giải chi tiết 

Gọi công thức tổng quát của phân tử Y là CxHyCOO(NH2)2

Phương trình hóa học phân tử Y và HCl

CxHyCOO(NH2)2 + 2HCl → CxHyCOOOH(NH3Cl)2

Ta có: 12x + y + 45 + 52,5.2 = 205 => 12x +  y = 55

Biện luận phương trình ta chọn được giá trị x = 4, y = 7 thỏa mãn

Vậy công thức phân tử của Y là C5H12N2O

Câu 5. Cho m gam axit glutamic tác dụng vừa đủ với 150 ml dung dịch KOH 1M. Giá trị của m là bao nhiêu

Đáp án hướng dẫn giải chi tiết

Theo đề bài ta có

nKOH = 0,15.1 = 0,15 mol

Phương trình hóa học xảy ra

HOOC-(CH2)2-CH(NH2)COOH + 2KOH → KOOC-(CH2)2-CH(NH2)COOK + 2H2O

0,075 ← 0,15 Mol

Theo phương trình phản ứng: naxit glutamic = 1/2nKOH = 1/2.0,15 = 0,075 mol

=> mglutamic = 0,075.147 = 11,025g

--------------------------

Trên đây VnDoc đã gửi tới bạn đọc tài liệu NH2C3H5(COOH)2 + NaOH → NH2C3H5(COONa)2 + H2O. Các bạn có thể các em cùng tham khảo thêm một số đề thi thử các môn tại: Thi thpt Quốc gia môn Toán, Thi THPT Quốc gia môn Vật Lý,....

Ngoài ra, VnDoc.com đã thành lập group chia sẻ tài liệu ôn tập THPT Quốc gia miễn phí trên Facebook: Tài liệu học tập lớp 12 Mời các bạn học sinh tham gia nhóm, để có thể nhận được những tài liệu, đề thi mới nhất.

Đánh giá bài viết
1 404
0 Bình luận
Sắp xếp theo
Phương trình phản ứng Xem thêm